Skip to content

Trigonometry

Intuition

Trigonometry is the mathematics of rotation and oscillation: The unit circle is the key — as you rotate around it, the xx-coordinate traces out cosθ\cos\theta and the yy-coordinate traces out sinθ\sin\theta. This connects circular motion to wave patterns, which is why trigonometry appears in physics (waves, SHM), engineering (signal processing), and music (sound waves).

Why it matters: Trigonometry is essential for any problem involving angles, periodic phenomena, or circular motion. It’s the bridge between geometry (shapes) and algebra (equations), and it’s the foundation for calculus (differentiation/integration of trig functions).

The key insight: The identity sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1 is just Pythagoras’ theorem applied to the unit circle. Every point on the unit circle satisfies x2+y2=1x^2 + y^2 = 1, and since x=cosθx = \cos\theta and y=sinθy = \sin\theta, the identity follows immediately. This is why trig identities are really just geometric relationships in disguise.

Board Coverage

BoardPaperNotes
AQAPaper 1, 2Basic trig in P1; compound/double angle, trig equations in P2
EdexcelP1, P2Similar split
OCR (A)Paper 1, 2Includes small angle approximations
CIE (9709)P1, P2, P3Trig functions in P1; identities and equations in P2; further trig in P3

1. The Unit Circle Definitions

Definition. Consider the unit circle (radius 1, centre at the origin). For an angle θ\theta Measured anticlockwise from the positive xx-axis, the point on the circle is (cosθ,sinθ)(\cos\theta, \sin\theta).

Definition.

cosθ=thexcoordinateofthepointontheunitcircleatangleθ\cos\theta = \mathrm{the } x\mathrm{-coordinate of the point on the unit circle at angle } \theta

sinθ=theycoordinateofthepointontheunitcircleatangleθ\sin\theta = \mathrm{the } y\mathrm{-coordinate of the point on the unit circle at angle } \theta

tanθ=sinθcosθ(cosθ0)\tan\theta = \frac{\sin\theta}{\cos\theta} \quad (\cos\theta \neq 0)

Intuition. These definitions extend the right-triangle definitions (SOH CAH TOA) to all angles, Not just those between 0° and 90°. The unit circle makes clear why sin\sin and cos\cos are periodic With period 2π2\pi.

1.1 Radian Measure

Definition. One radian is the angle subtended at the centre of a circle by an arc equal in Length to the radius.

θ(radians)=arclengthr\theta\mathrm{ (radians)} = \frac{\mathrm{arc length}}{r}

The full circle: 2π2\pi radians =360= 360^\circSo π\pi radians =180= 180^\circ.

Theorem (Arc length and sector area). For a sector of radius rr and angle θ\theta (in Radians):

Arclengths=rθ\mathrm{Arc length } s = r\theta

SectorareaA=12r2θ\mathrm{Sector area } A = \frac{1}{2}r^2\theta

Proof. By definition, θ=s/r\theta = s/rSo s=rθs = r\theta. The sector is a fraction θ2π\frac{\theta}{2\pi} of the full circle (area πr2\pi r^2), so A=θ2ππr2=12r2θA = \frac{\theta}{2\pi} \cdot \pi r^2 = \frac{1}{2}r^2\theta. \blacksquare


2. Fundamental Identities

2.1 Pythagorean Identity

Theorem. For all θR\theta \in \mathbb{R}:

sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1

Proof. The point (cosθ,sinθ)(\cos\theta, \sin\theta) lies on the unit circle x2+y2=1x^2 + y^2 = 1.

cos2θ+sin2θ=1\cos^2\theta + \sin^2\theta = 1 \quad \blacksquare

Corollary. Dividing by cos2θ\cos^2\theta (where cosθ0\cos\theta \neq 0):

1+tan2θ=sec2θ1 + \tan^2\theta = \sec^2\theta

Dividing by sin2θ\sin^2\theta (where sinθ0\sin\theta \neq 0):

cot2θ+1=cosec2θ\cot^2\theta + 1 = \cosec^2\theta


3. Compound Angle Formulas

3.1 Sine of a Sum

Theorem. For all A,BRA, B \in \mathbb{R}:

sin(A+B)=sinAcosB+cosAsinB\sin(A + B) = \sin A \cos B + \cos A \sin B

Proof (using rotation matrices). Consider the rotation of the plane by angle AA followed by Rotation by angle BB. The combined rotation is by angle A+BA + B.

The rotation matrix by angle θ\theta is:

R(θ)=(cosθsinθsinθcosθ)R(\theta) = \begin{pmatrix} \cos\theta & -\sin\theta \\ \sin\theta & \cos\theta \end{pmatrix}

Matrix multiplication gives: R(A)R(B)=R(A+B)R(A)R(B) = R(A + B).

(cosAsinAsinAcosA)(cosBsinBsinBcosB)=(cos(A+B)sin(A+B)sin(A+B)cos(A+B))\begin{pmatrix} \cos A & -\sin A \\ \sin A & \cos A \end{pmatrix}\begin{pmatrix} \cos B & -\sin B \\ \sin B & \cos B \end{pmatrix} = \begin{pmatrix} \cos(A+B) & -\sin(A+B) \\ \sin(A+B) & \cos(A+B) \end{pmatrix}

The (2,1)(2, 1) entry of the product is:

sinAcosB+cosAsinB=sin(A+B)\sin A \cos B + \cos A \sin B = \sin(A + B) \quad \blacksquare

3.2 Cosine of a Sum

Theorem.

cos(A+B)=cosAcosBsinAsinB\cos(A + B) = \cos A \cos B - \sin A \sin B

Proof. From the (1,1)(1, 1) entry of the matrix product above:

cosAcosBsinAsinB=cos(A+B)\cos A \cos B - \sin A \sin B = \cos(A + B) \quad \blacksquare

3.3 Tangent of a Sum

Theorem.

tan(A+B)=tanA+tanB1tanAtanB\tan(A + B) = \frac{\tan A + \tan B}{1 - \tan A \tan B}

Proof.

\begin\{aligned\} \tan(A + B) &= \frac\{\sin(A + B)\}\{\cos(A + B)\} \\ &= \frac\{\sin A \cos B + \cos A \sin B\}\{\cos A \cos B - \sin A \sin B\} \end\{aligned\}

Divide numerator and denominator by cosAcosB\cos A \cos B:

=tanA+tanB1tanAtanB= \frac{\tan A + \tan B}{1 - \tan A \tan B} \quad \blacksquare

3.4 Difference Formulas

Theorem.

\begin\{aligned\} \sin(A - B) &= \sin A \cos B - \cos A \sin B \\ \cos(A - B) &= \cos A \cos B + \sin A \sin B \\ \tan(A - B) &= \frac\{\tan A - \tan B\}\{1 + \tan A \tan B\} \end\{aligned\}

Proof. Replace BB with B-B in the sum formulas, using sin(B)=sinB\sin(-B) = -\sin B and cos(B)=cosB\cos(-B) = \cos B. \blacksquare


4. Double Angle Formulas

Setting A=BA = B in the compound angle formulas:

\begin\{aligned\} \sin 2A &= 2\sin A \cos A \\ \cos 2A &= \cos^2 A - \sin^2 A \\ \tan 2A &= \frac\{2\tan A\}\{1 - \tan^2 A\} \end\{aligned\}

Theorem. Three equivalent forms of cos2A\cos 2A:

cos2A=cos2Asin2A=2cos2A1=12sin2A\cos 2A = \cos^2 A - \sin^2 A = 2\cos^2 A - 1 = 1 - 2\sin^2 A

Proof. Using sin2A=1cos2A\sin^2 A = 1 - \cos^2 A:

cos2Asin2A=cos2A(1cos2A)=2cos2A1\cos^2 A - \sin^2 A = \cos^2 A - (1 - \cos^2 A) = 2\cos^2 A - 1

Using cos2A=1sin2A\cos^2 A = 1 - \sin^2 A:

cos2Asin2A=(1sin2A)sin2A=12sin2A\cos^2 A - \sin^2 A = (1 - \sin^2 A) - \sin^2 A = 1 - 2\sin^2 A \blacksquare

Intuition. The double angle formulas express functions of 2A2A purely in terms of functions of AA. They are the algebraic backbone of many trigonometric manipulations and are essential for Integration.


5. Solving Trigonometric Equations

5.1 Basic Strategy

  1. Use identities to reduce to a single trigonometric function.
  2. Solve the resulting equation.
  3. Find all solutions in the required interval.

5.2 Key Solutions

\begin\{aligned\} \sin\theta = a &\implies \theta = \arcsin(a) + 2n\pi \mathrm\{ or \} \pi - \arcsin(a) + 2n\pi \\ \cos\theta = a &\implies \theta = \pm\arccos(a) + 2n\pi \\ \tan\theta = a &\implies \theta = \arctan(a) + n\pi \end\{aligned\}

ExampleSolve 2sin2θ+3cosθ3=02\sin^2\theta + 3\cos\theta - 3 = 0 for 0θ<2π0 \leq \theta < 2\pi.

Using sin2θ=1cos2θ\sin^2\theta = 1 - \cos^2\theta:

2(1cos2θ)+3cosθ3=02(1 - \cos^2\theta) + 3\cos\theta - 3 = 0

2cos2θ+3cosθ1=0-2\cos^2\theta + 3\cos\theta - 1 = 0

2cos2θ3cosθ+1=02\cos^2\theta - 3\cos\theta + 1 = 0

(2cosθ1)(cosθ1)=0(2\cos\theta - 1)(\cos\theta - 1) = 0

cosθ=12    θ=π3\cos\theta = \frac{1}{2} \implies \theta = \frac{\pi}{3} or 5π3\frac{5\pi}{3}.

cosθ=1    θ=0\cos\theta = 1 \implies \theta = 0.

Solutions: θ=0,π3,5π3\theta = 0, \frac{\pi}{3}, \frac{5\pi}{3}.


6. Small Angle Approximations

Theorem. For small θ\theta (in radians):

\begin\{aligned\} \sin\theta &\approx \theta - \frac\{\theta^3\}\{6\} \\ \cos\theta &\approx 1 - \frac\{\theta^2\}\{2\} \\ \tan\theta &\approx \theta + \frac\{\theta^3\}\{3\} \end\{aligned\}

These follow from the Maclaurin series expansions (see Differentiation).

For the linear approximations (when θ\theta is very small):

sinθθ,cosθ1,tanθθ\sin\theta \approx \theta, \quad \cos\theta \approx 1, \quad \tan\theta \approx \theta

Intuition. Near the origin, the curves y=sinθy = \sin\theta and y=tanθy = \tan\theta are almost Indistinguishable from the line y=θy = \theta. The curve y=cosθy = \cos\theta is nearly flat at y=1y = 1.


7. Half-Angle Formulas

Theorem. For all θ\theta:

sinθ2=±1cosθ2\sin\frac{\theta}{2} = \pm\sqrt{\frac{1 - \cos\theta}{2}}

cosθ2=±1+cosθ2\cos\frac{\theta}{2} = \pm\sqrt{\frac{1 + \cos\theta}{2}}

tanθ2=sinθ1+cosθ=1cosθsinθ\tan\frac{\theta}{2} = \frac{\sin\theta}{1 + \cos\theta} = \frac{1 - \cos\theta}{\sin\theta}

7.1 Derivation

Starting from cos2A=12sin2A\cos 2A = 1 - 2\sin^2 A and substituting A=θ2A = \frac{\theta}{2}:

cosθ=12sin2θ2\cos\theta = 1 - 2\sin^2\frac{\theta}{2}

2sin2θ2=1cosθ2\sin^2\frac{\theta}{2} = 1 - \cos\theta

sinθ2=±1cosθ2\sin\frac{\theta}{2} = \pm\sqrt{\frac{1 - \cos\theta}{2}} \quad \blacksquare

Similarly, from cos2A=2cos2A1\cos 2A = 2\cos^2 A - 1:

cosθ=2cos2θ21\cos\theta = 2\cos^2\frac{\theta}{2} - 1

2cos2θ2=1+cosθ2\cos^2\frac{\theta}{2} = 1 + \cos\theta

cosθ2=±1+cosθ2\cos\frac{\theta}{2} = \pm\sqrt{\frac{1 + \cos\theta}{2}} \quad \blacksquare

7.2 Tangent Half-Angle Formulas

The tangent half-angle formulas avoid the ambiguity of the ±\pm sign:

tanθ2=sinθ1+cosθ\tan\frac{\theta}{2} = \frac{\sin\theta}{1 + \cos\theta}

Proof. Using the double angle formulas:

sinθ1+cosθ=2sinθ2cosθ21+(2cos2θ21)=2sinθ2cosθ22cos2θ2=sinθ2cosθ2=tanθ2\frac{\sin\theta}{1 + \cos\theta} = \frac{2\sin\frac{\theta}{2}\cos\frac{\theta}{2}}{1 + (2\cos^2\frac{\theta}{2} - 1)} = \frac{2\sin\frac{\theta}{2}\cos\frac{\theta}{2}}{2\cos^2\frac{\theta}{2}} = \frac{\sin\frac{\theta}{2}}{\cos\frac{\theta}{2}} = \tan\frac{\theta}{2} \quad \blacksquare

Similarly:

tanθ2=1cosθsinθ\tan\frac{\theta}{2} = \frac{1 - \cos\theta}{\sin\theta}

Proof. 1cosθsinθ=1(12sin2θ2)2sinθ2cosθ2=2sin2θ22sinθ2cosθ2=sinθ2cosθ2=tanθ2\frac{1 - \cos\theta}{\sin\theta} = \frac{1 - (1 - 2\sin^2\frac{\theta}{2})}{2\sin\frac{\theta}{2}\cos\frac{\theta}{2}} = \frac{2\sin^2\frac{\theta}{2}}{2\sin\frac{\theta}{2}\cos\frac{\theta}{2}} = \frac{\sin\frac{\theta}{2}}{\cos\frac{\theta}{2}} = \tan\frac{\theta}{2} \quad \blacksquare

7.3 Sign Determination

The ±\pm in the sine and cosine half-angle formulas depends on the quadrant of θ2\frac{\theta}{2} Not the quadrant of θ\theta itself. Always determine which quadrant θ2\frac{\theta}{2} lies in Before choosing the sign.

Quadrant of θ2\frac{\theta}{2}sinθ2\sin\frac{\theta}{2}cosθ2\cos\frac{\theta}{2}
I: 0<θ2<π20 \lt \frac{\theta}{2} \lt \frac{\pi}{2}++++
II: π2<θ2<π\frac{\pi}{2} \lt \frac{\theta}{2} \lt \pi++-
III: π<θ2<3π2\pi \lt \frac{\theta}{2} \lt \frac{3\pi}{2}--
IV: 3π2<θ2<2π\frac{3\pi}{2} \lt \frac{\theta}{2} \lt 2\pi-++

Worked exampleFind the exact value of sinπ8\sin\frac{\pi}{8}.

Since 0<π8<π20 \lt \frac{\pi}{8} \lt \frac{\pi}{2} (first quadrant), sinπ8>0\sin\frac{\pi}{8} > 0So we Take the positive root.

sinπ8=1cosπ42=1222=224=222\sin\frac{\pi}{8} = \sqrt{\frac{1 - \cos\frac{\pi}{4}}{2}} = \sqrt{\frac{1 - \frac{\sqrt{2}}{2}}{2}} = \sqrt{\frac{2 - \sqrt{2}}{4}} = \frac{\sqrt{2 - \sqrt{2}}}{2}


8. R-Addition Formula (Harmonic Form)

Theorem. For real numbers aa and bb:

asinθ+bcosθ=Rsin(θ+α)a\sin\theta + b\cos\theta = R\sin(\theta + \alpha)

Where R=a2+b2R = \sqrt{a^2 + b^2} and tanα=ba\tan\alpha = \dfrac{b}{a}.

8.1 Cosine Form

Alternatively, the same expression can be written as:

asinθ+bcosθ=Rcos(θβ)a\sin\theta + b\cos\theta = R\cos(\theta - \beta)

Where R=a2+b2R = \sqrt{a^2 + b^2} and tanβ=ab\tan\beta = \dfrac{a}{b}.

Both forms are equivalent; the choice between them is a matter of convenience depending on whether a Sine or cosine expansion is more natural for the problem at hand.

8.2 Derivation

Expand the right-hand side of the sine form:

Rsin(θ+α)=Rsinθcosα+RcosθsinαR\sin(\theta + \alpha) = R\sin\theta\cos\alpha + R\cos\theta\sin\alpha

Equating coefficients with asinθ+bcosθa\sin\theta + b\cos\theta:

Rcosα=a,Rsinα=bR\cos\alpha = a, \qquad R\sin\alpha = b

Squaring and adding: R2cos2α+R2sin2α=a2+b2R^2\cos^2\alpha + R^2\sin^2\alpha = a^2 + b^2So R2=a2+b2R^2 = a^2 + b^2 and R=a2+b2R = \sqrt{a^2 + b^2}.

Dividing the second equation by the first: tanα=ba\tan\alpha = \dfrac{b}{a}. \blacksquare

The cosine form is derived similarly by expanding Rcos(θβ)=Rcosθcosβ+RsinθsinβR\cos(\theta - \beta) = R\cos\theta\cos\beta + R\sin\theta\sin\beta and equating coefficients.

8.3 Applications: Maximum and Minimum

Since 1sin(θ+α)1-1 \leq \sin(\theta + \alpha) \leq 1:

Rasinθ+bcosθR-R \leq a\sin\theta + b\cos\theta \leq R

  • Maximum =R=a2+b2= R = \sqrt{a^2 + b^2}Occurring when θ+α=π2+2nπ\theta + \alpha = \frac{\pi}{2} + 2n\pi.
  • Minimum =R= -ROccurring when θ+α=3π2+2nπ\theta + \alpha = \frac{3\pi}{2} + 2n\pi.

Example: Finding maximum and minimumFind the maximum and minimum values of 3sinθ4cosθ3\sin\theta - 4\cos\theta and the values of θ\theta at Which they occur, for 0θ<2π0 \leq \theta \lt 2\pi.

R=9+16=5R = \sqrt{9 + 16} = 5.

Here a=3a = 3 and b=4b = -4. Writing 3sinθ4cosθ=5sin(θ+α)3\sin\theta - 4\cos\theta = 5\sin(\theta + \alpha) where tanα=43\tan\alpha = \dfrac{-4}{3}So α=arctan43\alpha = -\arctan\dfrac{4}{3}.

Maximum =5= 5 when θ+α=π2\theta + \alpha = \frac{\pi}{2}:

θ=π2α=π2+arctan432.214rad\theta = \frac{\pi}{2} - \alpha = \frac{\pi}{2} + \arctan\frac{4}{3} \approx 2.214 \mathrm{ rad}

Minimum =5= -5 when θ+α=3π2\theta + \alpha = \frac{3\pi}{2}:

θ=3π2α=3π2+arctan435.356rad\theta = \frac{3\pi}{2} - \alpha = \frac{3\pi}{2} + \arctan\frac{4}{3} \approx 5.356 \mathrm{ rad}

8.4 Solving Equations

The R-addition formula converts asinθ+bcosθ=ka\sin\theta + b\cos\theta = k into Rsin(θ+α)=kR\sin(\theta + \alpha) = kA Standard trigonometric equation.

Example: Solving an equationSolve sinθ+cosθ=1\sin\theta + \cos\theta = 1 for 0θ<2π0 \leq \theta \lt 2\pi.

R=1+1=2R = \sqrt{1 + 1} = \sqrt{2}, α=arctan1=π4\alpha = \arctan 1 = \frac{\pi}{4}.

2sin ⁣(θ+π4)=1\sqrt{2}\sin\!\left(\theta + \frac{\pi}{4}\right) = 1

sin ⁣(θ+π4)=12=sinπ4\sin\!\left(\theta + \frac{\pi}{4}\right) = \frac{1}{\sqrt{2}} = \sin\frac{\pi}{4}

θ+π4=π4+2nπorθ+π4=3π4+2nπ\theta + \frac{\pi}{4} = \frac{\pi}{4} + 2n\pi \quad \mathrm{or} \quad \theta + \frac{\pi}{4} = \frac{3\pi}{4} + 2n\pi

θ=2nπorθ=π2+2nπ\theta = 2n\pi \quad \mathrm{or} \quad \theta = \frac{\pi}{2} + 2n\pi

For 0θ<2π0 \leq \theta \lt 2\pi: θ=0\theta = 0 or θ=π2\theta = \frac{\pi}{2}.


9. Trigonometric Identities: Proof Strategies

Proving trigonometric identities is a core exam skill. The following strategies cover the most Common approaches.

9.1 Strategy 1: Work with One Side

Start from the more complicated side and simplify it until it matches the simpler side. This avoids The logical error of assuming what you are trying to prove.

9.2 Strategy 2: Express Everything in Sine and Cosine

Replace tan\tan, sec\sec, csc\csc, cot\cot with their definitions in terms of sin\sin and cos\cos: tanθ=sinθcosθ\tan\theta = \frac{\sin\theta}{\cos\theta}, secθ=1cosθ\sec\theta = \frac{1}{\cos\theta}Etc.

9.3 Strategy 3: Use Known Identities

Apply the Pythagorean identity, compound angle, or double angle formulas to create simplifications.

9.4 Strategy 4: Multiply by the Conjugate

When you see expressions of the form a±ba \pm b in a denominator or numerator, multiply top and Bottom by the conjugate aba \mp b to produce a difference of squares.

Example 1: Strategy 2 (express in sin and cos)Prove that cotA+tanA=2sin2A\cot A + \tan A = \dfrac{2}{\sin 2A}.

\begin\{aligned\} \cot A + \tan A &= \frac\{\cos A\}\{\sin A\} + \frac\{\sin A\}\{\cos A\} \\ &= \frac\{\cos^2 A + \sin^2 A\}\{\sin A \cos A\} \\ &= \frac\{1\}\{\sin A \cos A\} \\ &= \frac\{2\}\{2\sin A \cos A\} = \frac\{2\}\{\sin 2A\} \quad \blacksquare \end\{aligned\}

Example 2: Strategy 3 (use known identities)Prove that sin3A=3sinA4sin3A\sin 3A = 3\sin A - 4\sin^3 A.

\begin\{aligned\} \sin 3A &= \sin(2A + A) \\ &= \sin 2A \cos A + \cos 2A \sin A \\ &= 2\sin A \cos^2 A + (1 - 2\sin^2 A)\sin A \\ &= 2\sin A(1 - \sin^2 A) + \sin A - 2\sin^3 A \\ &= 2\sin A - 2\sin^3 A + \sin A - 2\sin^3 A \\ &= 3\sin A - 4\sin^3 A \quad \blacksquare \end\{aligned\}

Example 3: Strategy 4 (multiply by conjugate)Prove that 1secA+tanA=secAtanA\dfrac{1}{\sec A + \tan A} = \sec A - \tan A.

Multiply numerator and denominator by secAtanA\sec A - \tan A:

\begin\{aligned\} \frac\{1\}\{\sec A + \tan A\} \cdot \frac\{\sec A - \tan A\}\{\sec A - \tan A\} &= \frac\{\sec A - \tan A\}\{\sec^2 A - \tan^2 A\} \\ &= \frac\{\sec A - \tan A\}\{1 + \tan^2 A - \tan^2 A\} \\ &= \frac\{\sec A - \tan A\}\{1\} \\ &= \sec A - \tan A \quad \blacksquare \end\{aligned\}

Where we used sec2A=1+tan2A\sec^2 A = 1 + \tan^2 A so that sec2Atan2A=1\sec^2 A - \tan^2 A = 1.

Example 4: Strategy 1 (work with one side)Prove that cos2A1+sin2A=cosAsinAcosA+sinA\dfrac{\cos 2A}{1 + \sin 2A} = \dfrac{\cos A - \sin A}{\cos A + \sin A}.

Working from the LHS:

\begin\{aligned\} \frac\{\cos 2A\}\{1 + \sin 2A\} &= \frac\{\cos^2 A - \sin^2 A\}\{1 + 2\sin A \cos A\} \\ &= \frac\{(\cos A - \sin A)(\cos A + \sin A)\}\{\cos^2 A + 2\sin A\cos A + \sin^2 A\} \\ &= \frac\{(\cos A - \sin A)(\cos A + \sin A)\}\{(\cos A + \sin A)^2\} \\ &= \frac\{\cos A - \sin A\}\{\cos A + \sin A\} \quad \blacksquare \end\{aligned\}

10. Trigonometric Graphs

10.1 Key Features

FunctionPeriodAmplitudeDomainRange
sinx\sin x2π2\pi11R\mathbb{R}[1,1][-1, 1]
cosx\cos x2π2\pi11R\mathbb{R}[1,1][-1, 1]
tanx\tan xπ\piundefinedxπ2+nπx \neq \frac{\pi}{2} + n\piR\mathbb{R}

Key values of sin\sin and cos\cos:

Angle00π6\frac{\pi}{6}π4\frac{\pi}{4}π3\frac{\pi}{3}π2\frac{\pi}{2}π\pi3π2\frac{3\pi}{2}2π2\pi
sin\sin0012\frac{1}{2}22\frac{\sqrt{2}}{2}32\frac{\sqrt{3}}{2}11001-100
cos\cos1132\frac{\sqrt{3}}{2}22\frac{\sqrt{2}}{2}12\frac{1}{2}001-10011

10.2 Transformations

For the general form y=Asin(Bx+C)+Dy = A\sin(Bx + C) + D (and similarly for cos\cos):

  • A|A| is the amplitude (vertical stretch from the midline)
  • The period is 2πB\dfrac{2\pi}{|B|}
  • The phase shift is CB-\dfrac{C}{B} (horizontal shift)
  • DD is the vertical shift (midline is y=Dy = D)

For tan\tanThe period is πB\dfrac{\pi}{|B|} and amplitude is not defined.

Use the sliders to adjust the amplitude, period, phase shift, and Vertical translation of the trigonometric functions. Observe how each parameter affects the graph of y=Asin(Bx+C)+Dy = A\sin(Bx + C) + D.

Worked exampleDescribe the key features of y=2sin ⁣(2xπ3)y = 2\sin\!\left(2x - \frac{\pi}{3}\right) for 0x2π0 \leq x \leq 2\pi. Amplitude: A=2|A| = 2So the range is [2,2][-2, 2]. Period: 2πB=2π2=π\dfrac{2\pi}{|B|} = \dfrac{2\pi}{2} = \pi. Phase shift: CB=π/32=π6-\dfrac{C}{B} = -\dfrac{-\pi/3}{2} = \dfrac{\pi}{6} (shift right by π6\frac{\pi}{6}). Key points. The first cycle begins at x=π6x = \frac{\pi}{6} (where the curve crosses the midline Upward). Subsequent key points within [0,2π][0, 2\pi]: - Maximum at x=5π12x = \frac{5\pi}{12} (value 22) - Midline crossing (down) at x=2π3x = \frac{2\pi}{3} - Minimum at x=11π12x = \frac{11\pi}{12} (value 2-2) - Midline crossing (up) at x=7π6x = \frac{7\pi}{6} Since the period is π\piThe second cycle repeats with all xx-values shifted by π\pi: - Maximum at x=17π12x = \frac{17\pi}{12} (value 22) - Minimum at x=23π12x = \frac{23\pi}{12} (value 2-2) yy-intercept: y=2sin ⁣(π3)=31.73y = 2\sin\!\left(-\frac{\pi}{3}\right) = -\sqrt{3} \approx -1.73.

11. Problem Set

Problem 1. Prove that sin2θ1+cos2θ=tanθ\frac{\sin 2\theta}{1 + \cos 2\theta} = \tan\theta.

Solution\begin\{aligned\} \frac\{\sin 2\theta\}\{1 + \cos 2\theta\} &= \frac\{2\sin\theta\cos\theta\}\{1 + (2\cos^2\theta - 1)\} \\ &= \frac\{2\sin\theta\cos\theta\}\{2\cos^2\theta\} \\ &= \frac\{\sin\theta\}\{\cos\theta\} = \tan\theta \quad \blacksquare \end\{aligned\}

If you get this wrong, revise: Double angle formulas


Problem 2. Solve sin2x=sinx\sin 2x = \sin x for 0x<2π0 \leq x < 2\pi.

Solution2sinxcosx=sinx2\sin x\cos x = \sin x

sinx(2cosx1)=0\sin x(2\cos x - 1) = 0

sinx=0    x=0,π\sin x = 0 \implies x = 0, \pi.

2cosx1=0    cosx=12    x=π3,5π32\cos x - 1 = 0 \implies \cos x = \frac{1}{2} \implies x = \frac{\pi}{3}, \frac{5\pi}{3}.

Solutions: x=0,π3,π,5π3x = 0, \frac{\pi}{3}, \pi, \frac{5\pi}{3}.

If you get this wrong, revise: Solving trig equations


Problem 3. Express 4sinθ3cosθ4\sin\theta - 3\cos\theta in the form Rsin(θα)R\sin(\theta - \alpha)Where R>0R > 0 and 0<α<π20 < \alpha < \frac{\pi}{2}.

SolutionRsin(θα)=R(sinθcosαcosθsinα)=RcosαsinθRsinαcosθR\sin(\theta - \alpha) = R(\sin\theta\cos\alpha - \cos\theta\sin\alpha) = R\cos\alpha\sin\theta - R\sin\alpha\cos\theta.

Comparing coefficients: Rcosα=4R\cos\alpha = 4 and Rsinα=3R\sin\alpha = 3.

R2=42+32=25    R=5R^2 = 4^2 + 3^2 = 25 \implies R = 5

tanα=34    α=arctan(34)0.6435rad\tan\alpha = \frac{3}{4} \implies \alpha = \arctan\left(\frac{3}{4}\right) \approx 0.6435 \mathrm{ rad}

4sinθ3cosθ=5sin(θ0.6435)4\sin\theta - 3\cos\theta = 5\sin(\theta - 0.6435)

If you get this wrong, revise: Compound angle formulas


Problem 4. Find the exact value of sin75\sin 75^\circ.

Solutionsin75°=sin(45°+30°)=sin45°cos30°+cos45°sin30\sin 75° = \sin(45° + 30°) = \sin 45°\cos 30° + \cos 45°\sin 30^\circ

=2232+2212=6+24= \frac{\sqrt{2}}{2} \cdot \frac{\sqrt{3}}{2} + \frac{\sqrt{2}}{2} \cdot \frac{1}{2} = \frac{\sqrt{6} + \sqrt{2}}{4}

If you get this wrong, revise: Compound angle formulas


Problem 5. Prove that 1cos2θsin2θ=tanθ\frac{1 - \cos 2\theta}{\sin 2\theta} = \tan\theta.

Solution\begin\{aligned\} \frac\{1 - \cos 2\theta\}\{\sin 2\theta\} &= \frac\{1 - (1 - 2\sin^2\theta)\}\{2\sin\theta\cos\theta\} \\ &= \frac\{2\sin^2\theta\}\{2\sin\theta\cos\theta\} \\ &= \frac\{\sin\theta\}\{\cos\theta\} = \tan\theta \quad \blacksquare \end\{aligned\}

If you get this wrong, revise: Double angle formulas


Problem 6. A sector of a circle of radius 8 cm has an angle of 1.2 radians. Find the arc length And the area of the sector.

SolutionArc length: s=rθ=8×1.2=9.6s = r\theta = 8 \times 1.2 = 9.6 cm.

Area: A=12r2θ=12(64)(1.2)=38.4A = \frac{1}{2}r^2\theta = \frac{1}{2}(64)(1.2) = 38.4 cm².

If you get this wrong, revise: Radian measure


Problem 7. Solve 3cos2x+2sinx2=03\cos^2 x + 2\sin x - 2 = 0 for πxπ-\pi \leq x \leq \pi.

Solution3(1sin2x)+2sinx2=03(1 - \sin^2 x) + 2\sin x - 2 = 0

33sin2x+2sinx2=03 - 3\sin^2 x + 2\sin x - 2 = 0

3sin2x+2sinx+1=0-3\sin^2 x + 2\sin x + 1 = 0

3sin2x2sinx1=03\sin^2 x - 2\sin x - 1 = 0

(3sinx+1)(sinx1)=0(3\sin x + 1)(\sin x - 1) = 0

sinx=13    x=arcsin(13)0.3398\sin x = -\frac{1}{3} \implies x = \arcsin(-\frac{1}{3}) \approx -0.3398 or x=πarcsin(13)=π+0.33982.802x = -\pi - \arcsin(-\frac{1}{3}) = -\pi + 0.3398 \approx -2.802 (since 3.481>π3.481 > \piSubtract 2π2\pi to stay in [π,π][-\pi, \pi]).

sinx=1    x=π2\sin x = 1 \implies x = \frac{\pi}{2}.

Solutions: x2.802,0.340,π2x \approx -2.802, -0.340, \frac{\pi}{2}.

If you get this wrong, revise: Solving trig equations


Problem 8. Use small angle approximations to estimate sin0.05cos0.05\frac{\sin 0.05}{\cos 0.05}.

Solutionsin0.050.05\sin 0.05 \approx 0.05

cos0.0510.0522=10.00125=0.99875\cos 0.05 \approx 1 - \frac{0.05^2}{2} = 1 - 0.00125 = 0.99875

sin0.05cos0.050.050.998750.05006\frac{\sin 0.05}{\cos 0.05} \approx \frac{0.05}{0.99875} \approx 0.05006

(Alternatively, tan0.050.05\tan 0.05 \approx 0.05 directly.)

If you get this wrong, revise: Small angle approximations


Problem 9. Prove that 1+sin2Acos2A=tan ⁣(A+π4)\dfrac{1 + \sin 2A}{\cos 2A} = \tan\!\left(A + \dfrac{\pi}{4}\right).

SolutionWorking from the LHS:

\begin\{aligned\} \frac\{1 + \sin 2A\}\{\cos 2A\} &= \frac\{1 + 2\sin A \cos A\}\{\cos^2 A - \sin^2 A\} \\ &= \frac\{\sin^2 A + 2\sin A \cos A + \cos^2 A\}\{(\cos A - \sin A)(\cos A + \sin A)\} \\ &= \frac\{(\sin A + \cos A)^2\}\{(\cos A - \sin A)(\cos A + \sin A)\} \\ &= \frac\{\sin A + \cos A\}\{\cos A - \sin A\} \end\{aligned\}

Dividing numerator and denominator by cosA\cos A:

=tanA+11tanA= \frac{\tan A + 1}{1 - \tan A}

From the tangent compound angle formula:

tan ⁣(A+π4)=tanA+tanπ41tanAtanπ4=tanA+11tanA\tan\!\left(A + \frac{\pi}{4}\right) = \frac{\tan A + \tan\frac{\pi}{4}}{1 - \tan A \tan\frac{\pi}{4}} = \frac{\tan A + 1}{1 - \tan A} \quad \blacksquare

If you get this wrong, revise: Compound angle formulas


Problem 10. The area of a sector is 20cm220\mathrm{ cm}^2 and the arc length is 10cm10\mathrm{ cm}. Find the radius and the angle.

Solutions=rθ=10    θ=10rs = r\theta = 10 \implies \theta = \frac{10}{r}

A=12r2θ=12r210r=5r=20    r=4A = \frac{1}{2}r^2\theta = \frac{1}{2}r^2 \cdot \frac{10}{r} = 5r = 20 \implies r = 4

θ=104=2.5radians\theta = \frac{10}{4} = 2.5 \mathrm{ radians}

If you get this wrong, revise: Radian measure


Problem 11. Find the exact value of cosπ12\cos\dfrac{\pi}{12} using a half-angle formula.

Solutioncosπ12=cosπ/62\cos\frac{\pi}{12} = \cos\frac{\pi/6}{2}So we apply the half-angle formula with θ=π6\theta = \frac{\pi}{6}.

Since 0<π12<π20 \lt \frac{\pi}{12} \lt \frac{\pi}{2} (first quadrant), cosπ12>0\cos\frac{\pi}{12} > 0.

\begin\{aligned\} \cos\frac\{\pi\}\{12\} &= \sqrt\{\frac\{1 + \cos\frac\{\pi\}\{6\}\}\{2\}\} \\ &= \sqrt\{\frac\{1 + \frac\{\sqrt\{3\}\}\{2\}\}\{2\}\} \\ &= \sqrt\{\frac\{2 + \sqrt\{3\}\}\{4\}\} \\ &= \frac\{\sqrt\{2 + \sqrt\{3\}\}\}\{2\} \end\{aligned\}

This can also be verified using the compound angle formula: cosπ12=cos ⁣(π3π4)=cosπ3cosπ4+sinπ3sinπ4=6+24\cos\frac{\pi}{12} = \cos\!\left(\frac{\pi}{3} - \frac{\pi}{4}\right) = \cos\frac{\pi}{3}\cos\frac{\pi}{4} + \sin\frac{\pi}{3}\sin\frac{\pi}{4} = \frac{\sqrt{6} + \sqrt{2}}{4} And one can check that 2+32=6+24\dfrac{\sqrt{2+\sqrt{3}}}{2} = \dfrac{\sqrt{6}+\sqrt{2}}{4}.

If you get this wrong, revise: Half-angle formulas


Problem 12. Find the maximum value of 2sinθ+5cosθ2\sin\theta + 5\cos\theta and the smallest positive Value of θ\theta at which it occurs.

SolutionR=4+25=29R = \sqrt{4 + 25} = \sqrt{29}.

The maximum value is R=29R = \sqrt{29}.

Writing 2sinθ+5cosθ=29sin(θ+α)2\sin\theta + 5\cos\theta = \sqrt{29}\sin(\theta + \alpha) where tanα=52\tan\alpha = \dfrac{5}{2}.

The maximum occurs when sin(θ+α)=1\sin(\theta + \alpha) = 1I.e., θ+α=π2\theta + \alpha = \frac{\pi}{2}.

θ=π2α=π2arctan520.3805rad\theta = \frac{\pi}{2} - \alpha = \frac{\pi}{2} - \arctan\frac{5}{2} \approx 0.3805 \mathrm{ rad}

Since arctan521.1903<π2\arctan\frac{5}{2} \approx 1.1903 < \frac{\pi}{2}This θ\theta is positive and is the Smallest positive value.

If you get this wrong, revise: R-addition formula


Problem 13. Prove that sin3AsinAcos3AcosA=2\dfrac{\sin 3A}{\sin A} - \dfrac{\cos 3A}{\cos A} = 2.

Solution\begin\{aligned\} \frac\{\sin 3A\}\{\sin A\} - \frac\{\cos 3A\}\{\cos A\} &= \frac\{\sin 3A \cos A - \cos 3A \sin A\}\{\sin A \cos A\} \\ &= \frac\{\sin(3A - A)\}\{\sin A \cos A\} \\ &= \frac\{\sin 2A\}\{\sin A \cos A\} \\ &= \frac\{2\sin A \cos A\}\{\sin A \cos A\} \\ &= 2 \quad \blacksquare \end\{aligned\}

If you get this wrong, revise: Proof strategies


Problem 14. Solve sinθ+3cosθ=1\sin\theta + \sqrt{3}\cos\theta = 1 for 0θ<2π0 \leq \theta \lt 2\pi.

SolutionR=1+3=2R = \sqrt{1 + 3} = 2, α=arctan3=π3\alpha = \arctan\sqrt{3} = \frac{\pi}{3}.

2sin ⁣(θ+π3)=12\sin\!\left(\theta + \frac{\pi}{3}\right) = 1

sin ⁣(θ+π3)=12\sin\!\left(\theta + \frac{\pi}{3}\right) = \frac{1}{2}

θ+π3=π6+2nπorθ+π3=5π6+2nπ\theta + \frac{\pi}{3} = \frac{\pi}{6} + 2n\pi \quad \mathrm{or} \quad \theta + \frac{\pi}{3} = \frac{5\pi}{6} + 2n\pi

Case 1: θ=π6π3+2nπ=π6+2nπ\theta = \frac{\pi}{6} - \frac{\pi}{3} + 2n\pi = -\frac{\pi}{6} + 2n\pi.

For n=1n = 1: θ=π6+2π=11π6\theta = -\frac{\pi}{6} + 2\pi = \frac{11\pi}{6}.

Case 2: θ=5π6π3+2nπ=π2+2nπ\theta = \frac{5\pi}{6} - \frac{\pi}{3} + 2n\pi = \frac{\pi}{2} + 2n\pi.

For n=0n = 0: θ=π2\theta = \frac{\pi}{2}.

Solutions: θ=π2\theta = \frac{\pi}{2} or θ=11π6\theta = \frac{11\pi}{6}.

If you get this wrong, revise: R-addition formula


Problem 15. Prove that 1tan2A1+tan2A=cos2A\dfrac{1 - \tan^2 A}{1 + \tan^2 A} = \cos 2A.

SolutionUsing sec2A=1+tan2A\sec^2 A = 1 + \tan^2 A:

\begin\{aligned\} \frac\{1 - \tan^2 A\}\{1 + \tan^2 A\} &= \frac\{1 - \tan^2 A\}\{\sec^2 A\} \\ &= (1 - \tan^2 A)\cos^2 A \\ &= \cos^2 A - \tan^2 A \cos^2 A \\ &= \cos^2 A - \frac\{\sin^2 A\}\{\cos^2 A\} \cdot \cos^2 A \\ &= \cos^2 A - \sin^2 A \\ &= \cos 2A \quad \blacksquare \end\{aligned\}

If you get this wrong, revise: Proof strategies


Cross-References

  • Differentiation — Trigonometric derivatives and small angle approximations connect directly to differentiation techniques.
  • Integration — Trigonometric integrals and substitutions require fluency with the identities and substitutions covered here.
  • Further Pure Mathematics 1 — Complex numbers use modulus-argument form, which is built on the trigonometric functions defined in this topic.
  • Functions — Trigonometric functions are key examples of periodic, composite, and inverse functions.