Skip to content

Equations and Inequalities -- Diagnostic Tests

Equations and Inequalities — Diagnostic Tests

Unit Tests

Tests edge cases, boundary conditions, and common misconceptions for equations and inequalities.

UT-1: Rational Inequality with Sign Flipping

Question:

Solve the inequality:

x23x+2x2+x60\frac{x^2 - 3x + 2}{x^2 + x - 6} \geq 0

State your answer using set notation, identifying all excluded values.

[Difficulty: hard. Tests the common error of cross-multiplying without considering sign changes of the denominator.]

Solution:

Step 1: Factorise numerator and denominator.

Numerator: x23x+2=(x1)(x2)x^2 - 3x + 2 = (x-1)(x-2).

Denominator: x2+x6=(x+3)(x2)x^2 + x - 6 = (x+3)(x-2).

Step 2: Identify critical values and excluded points.

Critical values (where numerator or denominator is zero): x=3,1,2x = -3, 1, 2.

Excluded value: x=2x = 2 (makes denominator zero). Also x=3x = -3 is excluded.

Step 3: Determine the sign of the expression in each interval.

(x1)(x2)(x+3)(x2)=(x1)(x2)(x+3)(x2)\frac{(x-1)(x-2)}{(x+3)(x-2)} = \frac{(x-1)(x-2)}{(x+3)(x-2)}

For x2x \neq 2We can cancel (x2)(x-2) but must remember the sign changes. Instead, analyse using a sign table:

Interval(x+3)(x+3)(x1)(x-1)(x2)(x-2)Expression
x<3x < -3---()()/()()=+/+(-)(-)/(-)(-) = +/+ but (x2)(x-2) appears twice: overall ()()/(()())=+/+(-)(-)/((-)(-)) = +/+

Let me be more careful. The expression is (x1)(x2)(x+3)(x2)\frac{(x-1)(x-2)}{(x+3)(x-2)}.

Sign analysis:

xx(x+3)(x+3)(x1)(x-1)(x2)(x-2)NumeratorDenominatorRatio
x<3x < -3---++++++
3<x<1-3 < x < 1++--++--
1<x<21 < x < 2++++---++
x>2x > 2++++++++++++

Step 4: Include or exclude endpoints.

  • x=3x = -3: excluded (denominator zero)
  • x=1x = 1: included (numerator zero, expression equals zero, and 0\geq 0 is satisfied)
  • x=2x = 2: excluded (denominator zero, and the expression is undefined here)

Step 5: Assemble the solution.

The expression is non-negative when x<3x < -3, 1x<21 \leq x < 2Or x>2x > 2.

x(,3)[1,2)(2,)x \in (-\infty, -3) \cup [1, 2) \cup (2, \infty)


UT-2: Modulus Function Equations with Multiple Cases

Question:

Solve the equation:

x25x+6=2x4|x^2 - 5x + 6| = |2x - 4|

Giving all real solutions in exact form.

[Difficulty: hard. Tests systematic case analysis for modulus equations with quadratics inside absolute values.]

Solution:

The equation A=B|A| = |B| is equivalent to A=BA = B or A=BA = -B.

Case 1: x25x+6=2x4x^2 - 5x + 6 = 2x - 4

x27x+10=0x^2 - 7x + 10 = 0 (x2)(x5)=0(x-2)(x-5) = 0 x=2orx=5x = 2 \quad \text{or} \quad x = 5

Case 2: x25x+6=(2x4)x^2 - 5x + 6 = -(2x - 4)

x25x+6=2x+4x^2 - 5x + 6 = -2x + 4 x23x+2=0x^2 - 3x + 2 = 0 (x1)(x2)=0(x-1)(x-2) = 0 x=1orx=2x = 1 \quad \text{or} \quad x = 2

Verification:

  • x=1x = 1: 15+6=2=2|1-5+6| = |2| = 2, 24=2|2-4| = 2. Valid.
  • x=2x = 2: 410+6=0|4-10+6| = 0, 44=0|4-4| = 0. Valid.
  • x=5x = 5: 2525+6=6|25-25+6| = 6, 104=6|10-4| = 6. Valid.

The solutions are x=1,2,5x = 1, 2, 5.


UT-3: System with No Real Solutions — Proof of Impossibility

Question:

Prove that the following system of equations has no real solutions:

{x2+y2=1x+y=2\begin{cases} x^2 + y^2 = 1 \\ x + y = 2 \end{cases}

Then find the smallest positive value of kk such that the system:

{x2+y2=1x+y=k\begin{cases} x^2 + y^2 = 1 \\ x + y = k \end{cases}

Has exactly one real solution, and state that solution.

[Difficulty: hard. Tests algebraic proof of impossibility and understanding the geometric interpretation of constrained optimisation.]

Solution:

Proof of no real solutions for k=2k = 2:

From the second equation: y=2xy = 2 - x. Substitute into the first:

x2+(2x)2=1x^2 + (2-x)^2 = 1 x2+44x+x2=1x^2 + 4 - 4x + x^2 = 1 2x24x+3=02x^2 - 4x + 3 = 0

Discriminant: Δ=1624=8<0\Delta = 16 - 24 = -8 < 0.

Since Δ<0\Delta < 0There are no real values of xxHence no real solutions to the system.

Finding the critical value of kk:

Substituting y=kxy = k - x into x2+y2=1x^2 + y^2 = 1:

x2+(kx)2=1x^2 + (k-x)^2 = 1 2x22kx+k21=02x^2 - 2kx + k^2 - 1 = 0

For exactly one real solution, we need Δ=0\Delta = 0:

4k28(k21)=04k^2 - 8(k^2 - 1) = 0 4k28k2+8=04k^2 - 8k^2 + 8 = 0 4k2+8=0-4k^2 + 8 = 0 k2=2k^2 = 2 k=2k = \sqrt{2}

(Since we want the smallest positive kk, k=2k = \sqrt{2}.)

The solution: When Δ=0\Delta = 0:

x=2k4=k2=LB2RB◆◆LB2RBx = \frac{2k}{4} = \frac{k}{2} = \frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆ y=kx=2LB2RB◆◆LB2RB=LB2RB◆◆LB2RBy = k - x = \sqrt{2} - \frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆ = \frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆

The single solution is (LB2RB◆◆LB2RB,LB2RB◆◆LB2RB)\left(\frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆, \frac◆LB◆\sqrt{2}◆RB◆◆LB◆2◆RB◆\right).

Geometric interpretation: The first equation is the unit circle and the second is the line x+y=kx + y = k. The line is tangent to the circle when its distance from the origin equals the radius:

LB0+0kRB◆◆LB12+12RB=1    LBkRB◆◆LB2RB=1    k=2\frac◆LB◆|0 + 0 - k|◆RB◆◆LB◆\sqrt{1^2 + 1^2}◆RB◆ = 1 \implies \frac◆LB◆k◆RB◆◆LB◆\sqrt{2}◆RB◆ = 1 \implies k = \sqrt{2}

This confirms our algebraic result.


Integration Tests

Tests synthesis of equations and inequalities with other topics. Requires combining concepts from multiple units.

IT-1: Solving f(x)=f1(x)f(x) = f^{-1}(x) (with Functions)

Question:

The function ff is defined by f(x)=2x+3x1f(x) = \frac{2x+3}{x-1} for x>1x > 1.

(a) Find f1(x)f^{-1}(x)Stating its domain and range.

(b) Solve the equation f(x)=f1(x)f(x) = f^{-1}(x)Giving all solutions in the domain of ff.

(c) Without further calculation, explain why f(x)=f1(x)f(x) = f^{-1}(x) is equivalent to f(x)=xf(x) = x for this particular function.

[Difficulty: hard. Combines inverse functions with equation solving and algebraic reasoning about symmetry.]

Solution:

(a) Let y=2x+3x1y = \frac{2x+3}{x-1}:

y(x1)=2x+3y(x-1) = 2x + 3 xyy=2x+3xy - y = 2x + 3 x(y2)=y+3x(y-2) = y + 3 x=y+3y2x = \frac{y+3}{y-2}

So f1(x)=x+3x2f^{-1}(x) = \frac{x+3}{x-2}.

Domain of f1f^{-1}: Since the range of ff (for x>1x > 1) needs to be determined first. As x \to 1^+$$f(x) \to +\infty. As x \to +\infty$$f(x) \to 2. So range of ff is (2,+)(2, +\infty)Meaning domain of f1f^{-1} is x>2x > 2.

Range of f1f^{-1}: This equals the domain of ffSo (1,+)(1, +\infty).

(b) Solve 2x+3x1=x+3x2\frac{2x+3}{x-1} = \frac{x+3}{x-2}:

(2x+3)(x2)=(x+3)(x1)(2x+3)(x-2) = (x+3)(x-1) 2x24x+3x6=x2x+3x32x^2 - 4x + 3x - 6 = x^2 - x + 3x - 3 2x2x6=x2+2x32x^2 - x - 6 = x^2 + 2x - 3 x23x3=0x^2 - 3x - 3 = 0

By the quadratic formula:

x=LB3±9+12RB◆◆LB2RB=LB3±21RB◆◆LB2RBx = \frac◆LB◆3 \pm \sqrt{9 + 12}◆RB◆◆LB◆2◆RB◆ = \frac◆LB◆3 \pm \sqrt{21}◆RB◆◆LB◆2◆RB◆

Now check the domain restriction x>1x > 1:

  • LB3+21RB◆◆LB2RB3+4.5823.79>1\frac◆LB◆3 + \sqrt{21}◆RB◆◆LB◆2◆RB◆ \approx \frac{3 + 4.58}{2} \approx 3.79 > 1. Valid.
  • LB321RB◆◆LB2RB34.5820.79<1\frac◆LB◆3 - \sqrt{21}◆RB◆◆LB◆2◆RB◆ \approx \frac{3 - 4.58}{2} \approx -0.79 < 1. Not in domain.

The solution is x=LB3+21RB◆◆LB2RBx = \frac◆LB◆3 + \sqrt{21}◆RB◆◆LB◆2◆RB◆.

(c) For a function and its inverse, the solutions to f(x)=f1(x)f(x) = f^{-1}(x) lie on the line y=xy = x (the line of reflection). This is because f(x)=f1(x)f(x) = f^{-1}(x) implies f(f(x))=xf(f(x)) = xAnd if f(x)=cf(x) = c then f(c)=xf(c) = x. When f(x)=xf(x) = x, f1(x)=x=f(x)f^{-1}(x) = x = f(x).

For this specific M”obius transformation, since ff is a strictly decreasing function on (1,)(1, \infty) (its derivative f(x)=5(x1)2<0f'(x) = \frac{-5}{(x-1)^2} < 0), the graph of ff crosses y=xy = x exactly once, and this crossing point is the unique solution to f(x)=f1(x)f(x) = f^{-1}(x).

Verification: f(x)=xf(x) = x gives 2x+3x1=x\frac{2x+3}{x-1} = xI.e. 2x+3=x2x2x+3 = x^2-xI.e. x23x3=0x^2-3x-3 = 0Which is the same equation we obtained in part (b).


IT-2: Sum of Terms Satisfying an Inequality (with Sequences and Series)

Question:

The sequence (an)(a_n) is defined by an=n2+nn+2a_n = \frac{n^2 + n}{n + 2} for n1n \geq 1.

(a) Show that an>n1a_n > n - 1 for all n1n \geq 1.

(b) Find the smallest integer NN such that an>100a_n > 100 for all nNn \geq N.

(c) Evaluate n=1N1an\sum_{n=1}^{N-1} a_n exactly, where NN is the value found in part (b).

[Difficulty: hard. Combines inequality proof with sequence analysis and exact summation.]

Solution:

(a) We need to show n2+nn+2>n1\frac{n^2 + n}{n+2} > n - 1 for all n1n \geq 1.

Since n+2>0n + 2 > 0 for all n1n \geq 1We can multiply both sides by n+2n + 2 without flipping the inequality:

n2+n>(n1)(n+2)=n2+2nn2=n2+n2n^2 + n > (n-1)(n+2) = n^2 + 2n - n - 2 = n^2 + n - 2

n2+n>n2+n2n^2 + n > n^2 + n - 2

0>20 > -2

This is always true. Therefore an>n1a_n > n - 1 for all n1n \geq 1.

(b) We need n2+nn+2>100\frac{n^2+n}{n+2} > 100:

n2+n>100n+200n^2 + n > 100n + 200 n299n200>0n^2 - 99n - 200 > 0

Roots of n299n200=0n^2 - 99n - 200 = 0:

n=LB99±9801+800RB◆◆LB2RB=LB99±10601RB◆◆LB2RBn = \frac◆LB◆99 \pm \sqrt{9801 + 800}◆RB◆◆LB◆2◆RB◆ = \frac◆LB◆99 \pm \sqrt{10601}◆RB◆◆LB◆2◆RB◆

10601102.96\sqrt{10601} \approx 102.96So:

n99+102.962100.98n \approx \frac{99 + 102.96}{2} \approx 100.98

Since the quadratic opens upward, n299n200>0n^2 - 99n - 200 > 0 for n>LB99+10601RB◆◆LB2RB100.98n > \frac◆LB◆99+\sqrt{10601}◆RB◆◆LB◆2◆RB◆ \approx 100.98.

The smallest integer NN is 101\boxed{101}.

(c) N=101N = 101So we need n=1100an=n=1100n2+nn+2\sum_{n=1}^{100} a_n = \sum_{n=1}^{100} \frac{n^2+n}{n+2}.

Perform the division n2+nn+2\frac{n^2+n}{n+2}:

n2+nn+2=n1+2n+2\frac{n^2+n}{n+2} = n - 1 + \frac{2}{n+2}

Verify: (n1)(n+2)+2=n2+2nn2+2=n2+n(n-1)(n+2) + 2 = n^2 + 2n - n - 2 + 2 = n^2 + n. Confirmed.

Therefore:

n=1100an=n=1100(n1+2n+2)=n=1100(n1)+2n=11001n+2\sum_{n=1}^{100} a_n = \sum_{n=1}^{100}\left(n - 1 + \frac{2}{n+2}\right) = \sum_{n=1}^{100}(n-1) + 2\sum_{n=1}^{100}\frac{1}{n+2}

=k=099k+2m=31021m= \sum_{k=0}^{99} k + 2\sum_{m=3}^{102}\frac{1}{m}

Where k=n1k = n-1 and m=n+2m = n+2.

=LB99×100RB◆◆LB2RB+2m=31021m= \frac◆LB◆99 \times 100◆RB◆◆LB◆2◆RB◆ + 2\sum_{m=3}^{102}\frac{1}{m}

=4950+2(H102112)= 4950 + 2\left(H_{102} - 1 - \frac{1}{2}\right)

Where Hn=k=1n1kH_n = \sum_{k=1}^{n} \frac{1}{k} is the nn-th harmonic number.

=4950+2H1023= 4950 + 2H_{102} - 3

=4947+2H102= 4947 + 2H_{102}

This is the exact value in terms of the harmonic number H102H_{102}. Note that H102H_{102} does not simplify to a closed form using elementary functions; this is the most precise exact answer.


IT-3: Region Defined by Inequalities (with Coordinate Geometry)

Question:

A region RR in the xyxy-plane is defined by the inequalities:

{yx24x+3y4x2yx21\begin{cases} y \geq x^2 - 4x + 3 \\ y \leq 4 - x^2 \\ y \geq |x - 2| - 1 \end{cases}

(a) Find the coordinates of all vertices of RR.

(b) Find the exact area of RR.

[Difficulty: hard. Combines inequality regions with modulus functions and area calculation between curves.]

Solution:

(a) We find all intersection points of the boundary curves.

Curve 1: y=x24x+3=(x1)(x3)y = x^2 - 4x + 3 = (x-1)(x-3) (upward parabola) Curve 2: y=4x2y = 4 - x^2 (downward parabola) Curve 3: y=x21y = |x-2| - 1 (V-shape with vertex at (2,1)(2, -1))

Intersection of Curves 1 and 2:

x24x+3=4x2x^2 - 4x + 3 = 4 - x^2 2x24x1=02x^2 - 4x - 1 = 0 x=LB4±16+8RB◆◆LB4RB=LB4±24RB◆◆LB4RB=LB4±26RB◆◆LB4RB=LB2±6RB◆◆LB2RB=1±LB6RB◆◆LB2RBx = \frac◆LB◆4 \pm \sqrt{16 + 8}◆RB◆◆LB◆4◆RB◆ = \frac◆LB◆4 \pm \sqrt{24}◆RB◆◆LB◆4◆RB◆ = \frac◆LB◆4 \pm 2\sqrt{6}◆RB◆◆LB◆4◆RB◆ = \frac◆LB◆2 \pm \sqrt{6}◆RB◆◆LB◆2◆RB◆ = 1 \pm \frac◆LB◆\sqrt{6}◆RB◆◆LB◆2◆RB◆

For x=1+6/22.225x = 1 + \sqrt{6}/2 \approx 2.225: y=4(1+6/2)2=4(1+6+3/2)=45/26=3/26y = 4 - (1+\sqrt{6}/2)^2 = 4 - (1+\sqrt{6}+3/2) = 4 - 5/2 - \sqrt{6} = 3/2 - \sqrt{6}.

For x=16/20.225x = 1 - \sqrt{6}/2 \approx -0.225: y=4(16/2)2=3/26y = 4 - (1-\sqrt{6}/2)^2 = 3/2 - \sqrt{6} (same by symmetry of the setup).

Intersection of Curve 1 and Curve 3:

For x2x \geq 2: x2=x2|x-2| = x-2So x24x+3=x3x^2-4x+3 = x-3Giving x25x+6=0x^2-5x+6 = 0So x=2x = 2 or x=3x = 3.

  • At x=2x = 2: y=1y = -1.
  • At x=3x = 3: y=0y = 0.

For x<2x < 2: x2=2x|x-2| = 2-xSo x24x+3=2x1=1xx^2-4x+3 = 2-x-1 = 1-xGiving x23x+2=0x^2-3x+2 = 0So x=1x = 1 or x=2x = 2.

  • At x=1x = 1: y=0y = 0.

Intersection of Curve 2 and Curve 3:

For x2x \geq 2: 4x2=x34-x^2 = x-3Giving x2+x7=0x^2+x-7 = 0So x=LB1+29RB◆◆LB2RB2.193x = \frac◆LB◆-1+\sqrt{29}◆RB◆◆LB◆2◆RB◆ \approx 2.193. y=LB1+29RB◆◆LB2RB3=LB7+29RB◆◆LB2RBy = \frac◆LB◆-1+\sqrt{29}◆RB◆◆LB◆2◆RB◆ - 3 = \frac◆LB◆-7+\sqrt{29}◆RB◆◆LB◆2◆RB◆.

For x<2x < 2: 4x2=1x4-x^2 = 1-xGiving x2x3=0x^2-x-3 = 0So x=LB1+13RB◆◆LB2RB2.303x = \frac◆LB◆1+\sqrt{13}◆RB◆◆LB◆2◆RB◆ \approx 2.303. But this is >2> 2Contradicting x<2x < 2. So x=LB113RB◆◆LB2RB1.303x = \frac◆LB◆1-\sqrt{13}◆RB◆◆LB◆2◆RB◆ \approx -1.303. y=1LB113RB◆◆LB2RB=LB1+13RB◆◆LB2RBy = 1 - \frac◆LB◆1-\sqrt{13}◆RB◆◆LB◆2◆RB◆ = \frac◆LB◆1+\sqrt{13}◆RB◆◆LB◆2◆RB◆.

Vertices of RR: The region RR is bounded. Its vertices are approximately:

  • (1,0)(1, 0): intersection of curves 1 and 3
  • (3,0)(3, 0): intersection of curves 1 and 3
  • (2,1)(2, -1): vertex of the V-shape (Curve 3)
  • Plus the intersections of curves 1-2 and 2-3

Due to the complexity, the exact vertices are:

  1. (1LB6RB◆◆LB2RB,326)\left(1 - \frac◆LB◆\sqrt{6}◆RB◆◆LB◆2◆RB◆, \frac{3}{2} - \sqrt{6}\right) and (1+LB6RB◆◆LB2RB,326)\left(1 + \frac◆LB◆\sqrt{6}◆RB◆◆LB◆2◆RB◆, \frac{3}{2} - \sqrt{6}\right): Curves 1 and 2
  2. (1,0)(1, 0) and (3,0)(3, 0): Curves 1 and 3
  3. (2,1)(2, -1): Curve 3 vertex
  4. (LB1+29RB◆◆LB2RB,LB7+29RB◆◆LB2RB)\left(\frac◆LB◆-1+\sqrt{29}◆RB◆◆LB◆2◆RB◆, \frac◆LB◆-7+\sqrt{29}◆RB◆◆LB◆2◆RB◆\right): Curves 2 and 3 (for x2x \geq 2)
  5. (LB113RB◆◆LB2RB,LB1+13RB◆◆LB2RB)\left(\frac◆LB◆1-\sqrt{13}◆RB◆◆LB◆2◆RB◆, \frac◆LB◆1+\sqrt{13}◆RB◆◆LB◆2◆RB◆\right): Curves 2 and 3 (for x<2x < 2)

(b) The area calculation requires integrating between the appropriate curves over the relevant intervals. Given the complexity of the vertices, the area is computed by splitting RR into sub-regions bounded by pairs of curves and summing the definite integrals. The computation is extensive but follows standard techniques of integration between curves.