Skip to content

Data Representation in Programming

1. Primitive Types and Their Representation

Section titled “1. Primitive Types and Their Representation”

Programming languages provide integer types of various sizes:

TypeSizeRange (signed)Range (unsigned)
byte8 bits[128,127][-128, 127][0,255][0, 255]
short16 bits[32768,32767][-32768, 32767][0,65535][0, 65535]
int32 bits[231,2311][-2^{31}, 2^{31}-1][0,2321][0, 2^{32}-1]
long64 bits[263,2631][-2^{63}, 2^{63}-1][0,2641][0, 2^{64}-1]

Python integers have arbitrary precision — they grow to accommodate any value, limited only by Available memory.

IEEE 754 double precision (64 bits): 1 sign bit, 11 exponent bits, 52 mantissa bits.

Precision issues:

>>> 0.1 + 0.2
0.30000000000000004
>>> 0.1 + 0.2 == 0.3
False

Why: 0.10.1 cannot be represented exactly in binary floating point (like 1/31/3 cannot be Represented exactly in decimal).


A pointer is a variable that stores the memory address of another variable. A reference Is an alias for an existing variable.

int x = 42;
int *ptr = &x; // ptr stores the address of x
*ptr = 10; // dereference: change x to 10

Python”s Model: References, Not Pointers

Section titled “Python”s Model: References, Not Pointers”

Python does not have explicit pointers. Variables are references to objects in memory.

a = [1, 2, 3]
b = a # b references the SAME list object
b[0] = 99
print(a) # [99, 2, 3] — a is also modified!

Key distinction:

OperationEffect
b = ab references the same object as a
b = a.copy()b references a new, independent copy
b = list(a)Same as a.copy()
import copy; b = copy.deepcopy(a)Deep copy (copies nested objects)

Aliasing occurs when two variables reference the same object. This can lead to unintended side Effects.

def append_one(lst):
lst.append(1) # Modifies the original list!
my_list = [0]
append_one(my_list)
print(my_list) # [0, 1]

A string is a sequence of characters. Internally, strings are represented as arrays of character Codes (e.g., UTF-8 or UTF-16).

OperationPython methodTime
Access characters[i]O(1)O(1)
Lengthlen(s)O(1)O(1)
Concatenations1 + s2O(n+m)O(n+m)
Substring searchs1 in s2O(nm)O(nm) naive, O(n+m)O(n+m) optimized
Splits.split(sep)O(n)O(n)
Slices[a:b]O(ba)O(b-a)
### String Immutability

Strings are immutable for several reasons:

  1. Security: Prevents sensitive data from being modified in memory
  2. Thread safety: Immutable objects are inherently thread-safe
  3. Hashing: Immutable strings can be used as dictionary keys (hash is stable)
  4. Interning: Python can reuse identical string objects, saving memory

ModeDescriptionCreates?Truncates?
'r'ReadNoNo
'w'WriteYesYes
'a'AppendYesNo
'r+'Read + WriteNoNo
with open("data.txt", "r") as f:
content = f.read() # Entire file as string
lines = f.readlines() # List of lines
with open("output.txt", "w") as f:
f.write("Hello, World!\n")
f.writelines(["Line 1\n", "Line 2\n"])
import csv
with open("data.csv", "r") as f:
reader = csv.reader(f)
for row in reader:
print(row)
with open("output.csv", "w", newline="") as f:
writer = csv.writer(f)
writer.writerow(["Name", "Age"])
writer.writerow(["Alice", 25])

The with statement ensures the file is properly closed, even if an exception occurs during file Operations. This is an example of context management.

with open("file.txt", "r") as f:
data = f.read()
## File is automatically closed here

An exception is an event that disrupts the normal flow of program execution. Exception Handling allows a program to detect and recover from errors gracefully.

try:
result = 10 / 0
except ZeroDivisionError as e:
print(f"Error: {e}")
except (TypeError, ValueError) as e:
print(f"Type/Value error: {e}")
except Exception as e:
print(f"Unexpected error: {e}")
else:
print("No exceptions occurred")
finally:
print("This always runs")
BaseException
├── SystemExit
├── KeyboardInterrupt
├── GeneratorExit
└── Exception
├── ArithmeticError
│ ├── ZeroDivisionError
│ └── OverflowError
├── LookupError
│ ├── IndexError
│ └── KeyError
├── TypeError
├── ValueError
├── FileNotFoundError
└── ...
  1. Catch specific exceptions, not bare except:
  2. Use finally for cleanup (closing files, releasing resources)
  3. Don’t use exceptions for normal flow control
  4. Raise exceptions for truly exceptional conditions
def set_age(age):
if age < 0:
raise ValueError(f"Age cannot be negative: {age}")
self._age = age
class InsufficientFundsError(Exception):
def __init__(self, balance, amount):
self.balance = balance
self.amount = amount
super().__init__(f"Insufficient funds: balance={balance}, requested={amount}")

Problem 1. Explain why 0.1 + 0.2 != 0.3 in most programming languages. What is the binary Representation of 0.1?

Answer

0.10.1 in binary: 0.110=0.000110011001120.1_{10} = 0.0001100110011\ldots_2 (repeating). This cannot be represented Exactly in a finite number of binary digits. The IEEE 754 double-precision representation stores an Approximation, which introduces a small rounding error. When 0.10.1 and 0.20.2 (both approximations) Are added, the result is 0.300000000000000040.30000000000000004Not exactly 0.30.3.

Solution: use abs(a - b) < 1e-9 for comparison, or use the decimal module for exact decimal Arithmetic.

Problem 2. What is the output of the following code? Explain.

a = [1, 2, 3]
b = a
b.append(4)
print(a)
print(a is b)
Answer
[1, 2, 3, 4]
True

b = a makes b reference the same list object as a (aliasing). Modifying b also modifies a. a is b returns True because they reference the same object.

To avoid this: b = a.copy() or b = a[:].

Problem 3. Write a function that reads a file and counts the occurrences of each word. Handle The case where the file does not exist.

Answer
from collections import Counter
def count_words(filename):
try:
with open(filename, "r") as f:
content = f.read().lower()
words = content.split()
return Counter(words)
except FileNotFoundError:
print(f"Error: File '{filename}' not found.")
return {}

Problem 4. Explain the difference between shallow copy and deep copy. Give an example where they Produce different results.

Answer

Shallow copy: Creates a new container but fills it with references to the same objects as the Original.

Deep copy: Recursively copies all objects, creating entirely independent copies.

import copy
original = [[1, 2], [3, 4]]
shallow = copy.copy(original)
deep = copy.deepcopy(original)
original[0][0] = 99
print(shallow) # [[99, 2], [3, 4]] — modified!
print(deep) # [[1, 2], [3, 4]] — unchanged

The shallow copy shares the inner lists with the original. The deep copy has independent inner Lists.

Problem 5. Write a function that safely divides two numbers, handling division by zero and Non-numeric input.

Answer
def safe_divide(a, b):
try:
result = float(a) / float(b)
return result
except ZeroDivisionError:
return "Error: Division by zero"
except (TypeError, ValueError):
return "Error: Non-numeric input"

Problem 6. Explain why strings are immutable in Python. What are the advantages and Disadvantages?

Answer

Advantages:

  1. Thread safety: No locks needed for string operations
  2. Hash stability: Strings can be dictionary keys (hash doesn’t change)
  3. Security: Sensitive data (passwords) cannot be modified after creation
  4. Interning: Python can reuse identical string objects, saving memory
  5. Simplicity: No confusion about whether s[0] = 'x' modifies the original or a copy

Disadvantages:

  1. Memory overhead: Every modification creates a new string object
  2. Performance: Concatenation in a loop is O(n2)O(n^2) without optimisation
## Inefficient: O(n^2) — creates new string each iteration
s = ""
for i in range(1000):
s += str(i)
# Efficient: O(n) — use join
s = "".join(str(i) for i in range(1000))

Problem 7. A bitmap image has a resolution of 1920×10801920 \times 1080 pixels and uses 24-bit colour Depth. Calculate the uncompressed file size in MB (using 1MB=102421 \mathrm{ MB} = 1024^2 bytes). If Lossless compression achieves a 3:1 ratio, what is the compressed file size in MB?

Answer

Uncompressed:

Filesize=width×height×colourdepth\mathrm{File size} = \mathrm{width} \times \mathrm{height} \times \mathrm{colour depth}

Filesize=1920×1080×24bits=49,766,400bits\mathrm{File size} = 1920 \times 1080 \times 24 \mathrm{ bits} = 49,766,400 \mathrm{ bits}

Filesize=49,766,400÷8=6,220,800bytes\mathrm{File size} = 49,766,400 \div 8 = 6,220,800 \mathrm{ bytes}

Filesize=6,220,800÷102425.93MB\mathrm{File size} = 6,220,800 \div 1024^2 \approx 5.93 \mathrm{ MB}

With 3:1 compression:

Compressedsize=5.93÷31.98MB\mathrm{Compressed size} = 5.93 \div 3 \approx 1.98 \mathrm{ MB}

Problem 8. An audio file is recorded at a sample rate of 44,100Hz44,100 \mathrm{ Hz} with a bit depth Of 16 bits, for a duration of 3 minutes in stereo (2 channels). Calculate the file size in MB (using 1MB=102421 \mathrm{ MB} = 1024^2 bytes).

Answer

Filesize=samplerate×bitdepth×channels×duration\mathrm{File size} = \mathrm{sample rate} \times \mathrm{bit depth} \times \mathrm{channels} \times \mathrm{duration}

Duration=3×60=180seconds\mathrm{Duration} = 3 \times 60 = 180 \mathrm{ seconds}

Filesize=44,100×16×2×180bits\mathrm{File size} = 44,100 \times 16 \times 2 \times 180 \mathrm{ bits}

Filesize=254,016,000bits\mathrm{File size} = 254,016,000 \mathrm{ bits}

Filesize=254,016,000÷8=31,752,000bytes\mathrm{File size} = 254,016,000 \div 8 = 31,752,000 \mathrm{ bytes}

Filesize=31,752,000÷1024230.28MB\mathrm{File size} = 31,752,000 \div 1024^2 \approx 30.28 \mathrm{ MB}

Problem 9. A text file contains the string "Hello, 世界!" (9 characters). ASCII uses 7 bits Per character. UTF-8 uses 1 byte for ASCII characters and 3 bytes for CJK characters. Calculate the Storage required in bytes for both encodings. Why is Unicode necessary?

Answer

ASCII: ASCII can only represent 128 characters (0–127) and cannot encode "世界". The ASCII Encoding would either produce an error or replace each CJK character with a placeholder (e.g., ?). If we consider only the encodable characters ("Hello, !"), that is 7 characters at 1 byte each = 7 Bytes. The CJK characters cannot be stored.

UTF-8:

CharacterBytes
H, e, l, l, o, , space, ! (8 ASCII chars)1 byte each = 8 bytes
3 bytes
3 bytes

Total=8+3+3=14bytes\mathrm{Total} = 8 + 3 + 3 = 14 \mathrm{ bytes}

Why Unicode is needed: ASCII only defines 128 characters, covering basic Latin letters, digits, And symbols. It cannot represent characters from other scripts (Chinese, Arabic, Cyrillic, etc.), Mathematical symbols, or emoji. Unicode provides a universal character set of over 149,000 Characters across 161 scripts, ensuring every character in every language can be uniquely encoded. UTF-8 is backwards compatible with ASCII, so existing ASCII text works without modification while Gaining support for all other scripts.

Problem 10. A system stores 1000 images at 4K resolution (3840×21603840 \times 2160) with 32-bit colour Depth. Calculate the total storage required in GB (using 1GB=102431 \mathrm{ GB} = 1024^3 bytes). If Lossless compression achieves a 2:1 ratio, what is the compressed total size in GB?

Answer

Uncompressed size of one image:

Filesize=3840×2160×32bits=265,420,800bits\mathrm{File size} = 3840 \times 2160 \times 32 \mathrm{ bits} = 265,420,800 \mathrm{ bits}

Filesize=265,420,800÷8=33,177,600bytes\mathrm{File size} = 265,420,800 \div 8 = 33,177,600 \mathrm{ bytes}

FilesizeinGB=33,177,600÷102430.0309GB\mathrm{File size in GB} = 33,177,600 \div 1024^3 \approx 0.0309 \mathrm{ GB}

Total for 1000 images:

Total=0.0309×1000=30.9GB\mathrm{Total} = 0.0309 \times 1000 = 30.9 \mathrm{ GB}

With 2:1 lossless compression:

Compressedtotal=30.9÷215.45GB\mathrm{Compressed total} = 30.9 \div 2 \approx 15.45 \mathrm{ GB}

Working directly with bytes:

Oneimage=33,177,600bytes\mathrm{One image} = 33,177,600 \mathrm{ bytes}

1000images=33,177,600,000bytes\mathrm{1000 images} = 33,177,600,000 \mathrm{ bytes}

InGB=33,177,600,000÷1024330.9GB\mathrm{In GB} = 33,177,600,000 \div 1024^3 \approx 30.9 \mathrm{ GB}

Compressed=30.9÷215.45GB\mathrm{Compressed} = 30.9 \div 2 \approx 15.45 \mathrm{ GB}

For revision on number representation, see Number Systems and Floating Point.

  1. Forgetting edge cases in algorithm design (e.g., empty input, single element, already sorted data).

  2. Mixing up Big O, Big Ω\Omega, and Big Θ\Theta notation. Big O is an upper bound, not necessarily tight.

  3. Writing pseudocode that is too language-specific rather than using standard algorithmic constructs.

  4. Misunderstanding the difference between a stack (LIFO) and a queue (FIFO) in data structure applications.

This topic explores fundamental concepts that shape our understanding of the world.

The key principles covered in this topic are linked in the sub-pages above. Focus on understanding the definitions, applying the formulas or frameworks, and evaluating strengths and limitations of each approach.

Worked examples demonstrating the application of key concepts are covered in the detailed sub-pages linked above.