Skip to content

Thermodynamics & Energetics

Thermodynamics is like a bank account for energy — you can’t create or destroy it, only transfer or transform it.

A thermodynamic system is the part of the universe under study. The surroundings are everything else. The universe is the system plus the surroundings.

  • Open system: exchanges both matter and energy with surroundings.
  • Closed system: exchanges energy but not matter.
  • Isolated system: exchanges neither matter nor energy.

Enthalpy is a thermodynamic state function defined as:

H=U+pVH = U + pV

Where UU is internal energy, pp is pressure, and VV is volume. For constant-pressure processes (the usual condition in chemistry):

ΔH=qp\Delta H = q_p

The enthalpy change ΔH\Delta H is the heat exchanged at constant pressure. It cannot be measured absolutely; only changes in enthalpy are measurable.

The internal energy of a system is the total kinetic and potential energy of all particles within the system. At constant volume:

ΔU=qV\Delta U = q_V

The relationship between ΔH\Delta H and ΔU\Delta U:

ΔH=ΔU+Δ(pV)\Delta H = \Delta U + \Delta(pV)

For reactions involving only solids and liquids, Δ(pV)0\Delta(pV) \approx 0So ΔHΔU\Delta H \approx \Delta U. For reactions involving gases:

Δ(pV)=ΔngRT\Delta(pV) = \Delta n_g RT

Where Δng\Delta n_g is the change in moles of gas.

Standard enthalpy changes are measured under the following conditions:

  • Pressure: 100kPa100\,\mathrm{kPa} (1bar1\,\mathrm{bar}Approximately 1atm1\,\mathrm{atm}).
  • Temperature: 298K298\,\mathrm{K} (25C25^\circ\mathrm{C}), unless otherwise stated.
  • Concentration: 1mol/dm31\,\mathrm{mol/dm}^3 for solutions.
  • All substances in their standard states (most stable form at the specified conditions).

The standard symbol is ΔH\Delta H^\circ with the superscript circle.

  • Exothermic: ΔH<0\Delta H \lt 0; heat is released to the surroundings.
  • Endothermic: ΔH>0\Delta H \gt 0; heat is absorbed from the surroundings.

Hess’s Law states that the enthalpy change for a chemical reaction is the same regardless of the route by which the reaction occurs, provided the initial and final conditions are the same.

This is a direct consequence of enthalpy being a state function — its value depends only on the current state of the system, not on the path taken to reach it.

Application: Indirect Determination of Enthalpy Changes

Section titled “Application: Indirect Determination of Enthalpy Changes”

Worked Example 1. Calculate ΔHf\Delta H_f^\circ of C2H5OH(l)\mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l).

Given:

  • ΔHc(C)=394kJ/mol\Delta H_c^\circ(\mathrm{C}) = -394\,\mathrm{kJ/mol}
  • ΔHc(H2)=286kJ/mol\Delta H_c^\circ(\mathrm{H}_2) = -286\,\mathrm{kJ/mol}
  • ΔHc(C2H5OH)=1367kJ/mol\Delta H_c^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) = -1367\,\mathrm{kJ/mol}

Formation: 2C(s)+3H2(g)+12O2(g)C2H5OH(l)2\mathrm{C}(s) + 3\mathrm{H}_2(g) + \tfrac{1}{2}\mathrm{O}_2(g) \to \mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l)

Combustion route: 2C(s)+3H2(g)+312O2(g)2CO2(g)+3H2O(l)2\mathrm{C}(s) + 3\mathrm{H}_2(g) + 3\frac{1}{2}\mathrm{O}_2(g) \to 2\mathrm{CO}_2(g) + 3\mathrm{H}_2\mathrm{O}(l)

By Hess’s Law:

ΔHf+ΔHc(C2H5OH)=2ΔHc(C)+3ΔHc(H2)\Delta H_f^\circ + \Delta H_c^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) = 2\Delta H_c^\circ(\mathrm{C}) + 3\Delta H_c^\circ(\mathrm{H}_2) ΔHf=2(394)+3(286)(1367)=788858+1367=279kJ/mol\Delta H_f^\circ = 2(-394) + 3(-286) - (-1367) = -788 - 858 + 1367 = -279\,\mathrm{kJ/mol}

Standard Enthalpy of Formation (ΔHf\Delta H_f^\circ)

Section titled “Standard Enthalpy of Formation (ΔHf∘\Delta H_f^\circΔHf∘​)”

The enthalpy change when one mole of a compound is formed from its constituent elements in their standard states under standard conditions.

  • ΔHf\Delta H_f^\circ of an element in its standard state is zero by definition.
  • Example: ΔHf(H2O(l))=286kJ/mol\Delta H_f^\circ(\mathrm{H}_2\mathrm{O}(l)) = -286\,\mathrm{kJ/mol}.

Standard Enthalpy of Combustion (ΔHc\Delta H_c^\circ)

Section titled “Standard Enthalpy of Combustion (ΔHc∘\Delta H_c^\circΔHc∘​)”

The enthalpy change when one mole of a substance is completely burned in excess oxygen under standard conditions.

  • Combustion reactions are always exothermic (ΔHc<0\Delta H_c^\circ \lt 0).
  • The products must be in their standard states (CO2(g)\mathrm{CO}_2(g), H2O(l)\mathrm{H}_2\mathrm{O}(l)Etc.).

Standard Enthalpy of Atomisation (ΔHat\Delta H_\mathrm{at}^\circ)

Section titled “Standard Enthalpy of Atomisation (ΔHat∘\Delta H_\mathrm{at}^\circΔHat∘​)”

The enthalpy change when one mole of gaseous atoms is formed from an element in its standard state.

For a diatomic molecule X2\mathrm{X}_2:

ΔHat=12×bonddissociationenthalpyofX2\Delta H_\mathrm{at}^\circ = \frac{1}{2} \times \mathrm{bond dissociation enthalpy of } \mathrm{X}_2

Example: ΔHat(Cl2)=12(242)=121kJ/mol\Delta H_\mathrm{at}^\circ(\mathrm{Cl}_2) = \tfrac{1}{2}(242) = 121\,\mathrm{kJ/mol}.

For a solid element (e.g. Na), atomisation includes sublimation and bond breaking:

Na(s)Na(g)ΔHat=+108kJ/mol\mathrm{Na}(s) \to \mathrm{Na}(g) \quad \Delta H_\mathrm{at}^\circ = +108\,\mathrm{kJ/mol}

The bond dissociation enthalpy is the enthalpy change required to break one mole of a specific bond in a specific molecule in the gaseous phase.

For a diatomic molecule, this is unambiguous. For polyatomic molecules, each bond-breaking step may have a different enthalpy. Mean bond enthalpies are averages across a range of compounds.

Note: CH\mathrm{C-H} bond energy in CH4\mathrm{CH}_4 is not the same as in CH3Cl\mathrm{CH}_3\mathrm{Cl}. Mean bond enthalpies introduce systematic error in thermochemical calculations.

The lattice enthalpy ΔHlat\Delta H_\mathrm{lat}^\circ is the enthalpy change when one mole of an ionic solid is formed from its constituent gaseous ions under standard conditions. This is always exothermic (ΔHlat<0\Delta H_\mathrm{lat}^\circ \lt 0).

The reverse process (separating one mole of solid into gaseous ions) is the lattice dissociation enthalpy and is always endothermic.

The Born-Haber cycle for an ionic compound MaXb\mathrm{M}_a\mathrm{X}_b constructs a thermochemical cycle:

ΔHf=aΔHat(M)+bΔHat(X)+IE(M)+EA(X)+ΔHlat\Delta H_f^\circ = a\Delta H_\mathrm{at}^\circ(\mathrm{M}) + b\Delta H_\mathrm{at}^\circ(\mathrm{X}) + \sum \mathrm{IE}(\mathrm{M}) + \sum \mathrm{EA}(\mathrm{X}) + \Delta H_\mathrm{lat}^\circ

Rearranging gives the lattice enthalpy.

Worked Example. Calculate the lattice enthalpy of MgO\mathrm{MgO} given:

  • ΔHf(MgO)=602kJ/mol\Delta H_f^\circ(\mathrm{MgO}) = -602\,\mathrm{kJ/mol}
  • ΔHat(Mg)=+148kJ/mol\Delta H_\mathrm{at}^\circ(\mathrm{Mg}) = +148\,\mathrm{kJ/mol}
  • ΔHat(O)=+248kJ/mol\Delta H_\mathrm{at}^\circ(\mathrm{O}) = +248\,\mathrm{kJ/mol} (per atom; for 12O2\tfrac{1}{2}\mathrm{O}_2)
  • IE1(Mg)=+738kJ/mol\mathrm{IE}_1(\mathrm{Mg}) = +738\,\mathrm{kJ/mol}
  • IE2(Mg)=+1451kJ/mol\mathrm{IE}_2(\mathrm{Mg}) = +1451\,\mathrm{kJ/mol}
  • EA1(O)=141kJ/mol\mathrm{EA}_1(\mathrm{O}) = -141\,\mathrm{kJ/mol}
  • EA2(O)=+798kJ/mol\mathrm{EA}_2(\mathrm{O}) = +798\,\mathrm{kJ/mol}
ΔHlat=ΔHfΔHat(Mg)ΔHat(O)IE1IE2EA1EA2\Delta H_\mathrm{lat}^\circ = \Delta H_f^\circ - \Delta H_\mathrm{at}^\circ(\mathrm{Mg}) - \Delta H_\mathrm{at}^\circ(\mathrm{O}) - \mathrm{IE}_1 - \mathrm{IE}_2 - \mathrm{EA}_1 - \mathrm{EA}_2 ΔHlat=6021482487381451(141)798\Delta H_\mathrm{lat}^\circ = -602 - 148 - 248 - 738 - 1451 - (-141) - 798 ΔHlat=6021482487381451+141798=3844kJ/mol\Delta H_\mathrm{lat}^\circ = -602 - 148 - 248 - 738 - 1451 + 141 - 798 = -3844\,\mathrm{kJ/mol}

Theoretical Lattice Enthalpy: Born-Lande Equation

Section titled “Theoretical Lattice Enthalpy: Born-Lande Equation”

The theoretical lattice enthalpy is calculated from the electrostatic model:

ΔHlatNAMz+ze24πε0r0(11n)\Delta H_\mathrm{lat}^\circ \approx -\frac{N_A M z^+ z^- e^2}{4\pi\varepsilon_0 r_0}\left(1 - \frac{1}{n}\right)

Where:

  • NAN_A is Avogadro’s constant
  • MM is the Madelung constant (depends on the lattice geometry)
  • z+z^+, zz^- are the ion charges
  • ee is the elementary charge
  • ε0\varepsilon_0 is the permittivity of free space
  • r0r_0 is the sum of the ionic radii
  • nn is the Born exponent (related to the electron configuration of the ions)

This equation predicts purely ionic bonding. Differences between theoretical and experimental (Born-Haber) lattice enthalpies indicate the degree of covalent character in the ionic bond.

Polarisation and Covalent Character (Fajans’ Rules)

Section titled “Polarisation and Covalent Character (Fajans’ Rules)”

A small, highly charged cation (high charge density) can polarise a large, deformable anion, drawing electron density towards itself and introducing covalent character.

Fajans’ Rules predict increasing covalent character when:

  1. The cation is small and/or highly charged (e.g. Al3+\mathrm{Al}^{3+}).
  2. The anion is large and/or highly charged (e.g. I\mathrm{I}^-).
  3. The cation has an electronic configuration resembling a noble gas with no inert pair (e.g. Li+\mathrm{Li}^+ vs Tl+\mathrm{Tl}^+).

Example: AgI\mathrm{AgI} has significant covalent character because Ag+\mathrm{Ag}^+ is a relatively soft cation and I\mathrm{I}^- is a large, polarisable anion. The experimental lattice enthalpy is less exothermic than the theoretical value.

Entropy is a measure of the number of ways energy can be distributed among the particles of a system — a measure of disorder or randomness.

The second law of thermodynamics states that the total entropy of the universe increases in any spontaneous process:

ΔSuniverse=ΔSsystem+ΔSsurroundings>0\Delta S_\mathrm{universe} = \Delta S_\mathrm{system} + \Delta S_\mathrm{surroundings} \gt 0
FactorEffect on SS
More particles (gaseous products)Increase
Higher temperatureIncrease
Change from solid to liquid to gasIncrease
Dissolution of a solid (if ions are dispersed)Increase
Fewer moles of gasDecrease

Standard Entropy Change (ΔS\Delta S^\circ)

Section titled “Standard Entropy Change (ΔS∘\Delta S^\circΔS∘)”
ΔS=S(products)S(reactants)\Delta S^\circ = \sum S^\circ(\mathrm{products}) - \sum S^\circ(\mathrm{reactants})

Standard entropies are always positive (absolute values, not relative like enthalpy).

Worked Example. Calculate ΔS\Delta S^\circ for:

CaCO3(s)CaO(s)+CO2(g)\mathrm{CaCO}_3(s) \to \mathrm{CaO}(s) + \mathrm{CO}_2(g)

Given: S^\circ(\mathrm{CaCO}_3) = 92.9\,\mathrm{J\,mol^{-1}\,K^{-1}}$$S^\circ(\mathrm{CaO}) = 38.1\,\mathrm{J\,mol^{-1}\,K^{-1}}$$S^\circ(\mathrm{CO}_2) = 213.7\,\mathrm{J\,mol^{-1}\,K^{-1}}.

ΔS=(38.1+213.7)92.9=251.892.9=+158.9Jmol1K1\Delta S^\circ = (38.1 + 213.7) - 92.9 = 251.8 - 92.9 = +158.9\,\mathrm{J\,mol^{-1}\,K^{-1}}

The entropy increases because a gas is produced from a solid (more microstates).

ΔSsurroundings=ΔHT\Delta S_\mathrm{surroundings} = -\frac{\Delta H}{T}

For an exothermic reaction (ΔH<0\Delta H \lt 0), ΔSsurroundings>0\Delta S_\mathrm{surroundings} \gt 0 (the surroundings gain heat, increasing their disorder).

The Gibbs free energy combines enthalpy and entropy into a single criterion for spontaneity:

ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S
ΔG\Delta GSpontaneity
ΔG<0\Delta G \lt 0Spontaneous (thermodynamically favourable)
ΔG=0\Delta G = 0At equilibrium
ΔG>0\Delta G \gt 0Non-spontaneous (thermodynamically unfavourable)

This is valid at constant temperature and pressure (standard laboratory conditions).

Standard Gibbs Free Energy Change (ΔG\Delta G^\circ)

Section titled “Standard Gibbs Free Energy Change (ΔG∘\Delta G^\circΔG∘)”
ΔG=ΔHTΔS\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ

The relationship between ΔG\Delta G^\circ and the equilibrium constant:

ΔG=RTlnK\Delta G^\circ = -RT\ln K

Where R=8.314Jmol1K1R = 8.314\,\mathrm{J\,mol^{-1}\,K^{-1}} and TT is in Kelvin.

When ΔG=0\Delta G^\circ = 0: K=1K = 1 (equal amounts of reactants and products at equilibrium).

When ΔG<0\Delta G^\circ \lt 0: K>1K \gt 1 (products favoured).

When ΔG>0\Delta G^\circ \gt 0: K<1K \lt 1 (reactants favoured).

ΔH\Delta HΔS\Delta SSpontaneity
- (exothermic)++ (entropy increases)Spontaneous at all temperatures
- (exothermic)- (entropy decreases)Spontaneous at low temperatures
++ (endothermic)++ (entropy increases)Spontaneous at high temperatures
++ (endothermic)- (entropy decreases)Non-spontaneous at all temperatures

Worked Example. For the thermal decomposition of CaCO3\mathrm{CaCO}_3:

CaCO3(s)CaO(s)+CO2(g)\mathrm{CaCO}_3(s) \to \mathrm{CaO}(s) + \mathrm{CO}_2(g)

\Delta H^\circ = +178\,\mathrm{kJ/mol}$$\Delta S^\circ = +160\,\mathrm{J\,mol^{-1}\,K^{-1}}.

At what temperature does the reaction become spontaneous?

ΔG=0    T=ΔHΔS=178×103160=1113K=840C\Delta G^\circ = 0 \implies T = \frac{\Delta H^\circ}{\Delta S^\circ} = \frac{178 \times 10^3}{160} = 1113\,\mathrm{K} = 840^\circ\mathrm{C}

Above 1113\,\mathrm{K}$$\Delta G^\circ \lt 0 and the decomposition is spontaneous.

((ΔG/T)T)p=ΔHT2\left(\frac{\partial (\Delta G/T)}{\partial T}\right)_p = -\frac{\Delta H}{T^2}

This shows how ΔG/T\Delta G/T varies with temperature. In the simplified form used at A-Level, it justifies the linear relationship:

ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S

A plot of ΔG\Delta G vs TT is linear with gradient =ΔS= -\Delta S and y-intercept =ΔH= \Delta H.

The relationship between ΔG\Delta G^\circ and the equilibrium constant KK is one of the most important equations in physical chemistry:

ΔG=RTlnK\Delta G^\circ = -RT\ln K

This equation allows prediction of the equilibrium position from thermodynamic data:

  • When ΔG<0\Delta G^\circ \lt 0: K>1K \gt 1Products are favoured at equilibrium.
  • When ΔG=0\Delta G^\circ = 0: K=1K = 1Reactants and products are present in equal amounts.
  • When ΔG>0\Delta G^\circ \gt 0: K<1K \lt 1Reactants are favoured at equilibrium.

Worked Example. Calculate KK at 298K298\,\mathrm{K} for the reaction N2O4(g)2NO2(g)\mathrm{N}_2\mathrm{O}_4(g) \rightleftharpoons 2\mathrm{NO}_2(g) given ΔG=+4.72kJ/mol\Delta G^\circ = +4.72\,\mathrm{kJ/mol}.

K=exp(ΔGRT)=exp(47208.314×298)=exp(1.904)=0.149K = \exp\left(\frac{-\Delta G^\circ}{RT}\right) = \exp\left(\frac{-4720}{8.314 \times 298}\right) = \exp(-1.904) = 0.149

K=0.149K = 0.149So reactants (N2O4\mathrm{N}_2\mathrm{O}_4) are favoured at equilibrium.

Using ΔG=ΔHTΔS\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ with the equilibrium expression:

Combining the two equations:

RTlnK=ΔHTΔS-RT\ln K = \Delta H^\circ - T\Delta S^\circ lnK=ΔHRT+ΔSR\ln K = -\frac{\Delta H^\circ}{RT} + \frac{\Delta S^\circ}{R}

This is the van ‘t Hoff equation (linear form), which is identical in structure to the Arrhenius equation.

Experimental Determination of Enthalpy Changes

Section titled “Experimental Determination of Enthalpy Changes”

Coffee-cup calorimetry: A polystyrene cup minimises heat exchange with the surroundings. The heat absorbed by the solution equals the heat released by the reaction:

Q=mcΔTQ = mc\Delta T

Where mm is the mass of solution (g), cc is the specific heat capacity (4.18Jg1K14.18\,\mathrm{J\,g^{-1}\,K^{-1}} for water), and ΔT\Delta T is the temperature change.

Sources of error in calorimetry:

  1. Heat loss to the surroundings (exothermic reactions underestimate ΔH\Delta H; endothermic reactions overestimate it).
  2. The calorimeter itself absorbs heat (qcalorimeter=CcalΔTq_\mathrm{calorimeter} = C_\mathrm{cal}\Delta T). For accurate work, include this.
  3. Incomplete reaction (if the reaction does not go to completion).
  4. Non-standard conditions (reactions are not at 298K298\,\mathrm{K} or 100kPa100\,\mathrm{kPa}).

Hess’s Law Cycles with Mean Bond Enthalpies

Section titled “Hess’s Law Cycles with Mean Bond Enthalpies”

Mean bond enthalpies are averages across different molecules. They introduce systematic error because the actual bond enthalpy in a specific molecule may differ from the mean.

Example of systematic error: The C—O bond enthalpy in CH3OH\mathrm{CH}_3\mathrm{OH} differs from the mean C—O bond enthalpy (which averages C—O bonds in alcohols, ethers, esters, carboxylic acids). Using mean values for a specific molecule gives only an estimate of ΔH\Delta H.

Rule: Calculations using mean bond enthalpies give estimated values. Calculations using standard enthalpies of formation give accurate values (provided the data are reliable). Always use formation enthalpies in preference to bond enthalpies when both are available.

The enthalpy of neutralisation is the enthalpy change when one mole of water is formed from the reaction of an acid and a base:

H+(aq)+OH(aq)H2O(l)ΔHneut=57.9kJ/mol\mathrm{H}^+(aq) + \mathrm{OH}^-(aq) \to \mathrm{H}_2\mathrm{O}(l) \quad \Delta H^\circ_\mathrm{neut} = -57.9\,\mathrm{kJ/mol}

This value is approximately constant for all strong acid-strong base reactions because the net ionic equation is always the same. Weak acid-strong base or strong acid-weak base neutralisations have less exothermic values because some energy is consumed in dissociating the weak acid or weak base.

Reaction typeΔHneut\Delta H_\mathrm{neut} (kJ/mol\mathrm{kJ/mol})Explanation
Strong acid + strong base57.9-57.9Full ionisation of both
Weak acid + strong base56.1-56.1 (e.g. CH3COOH+NaOH\mathrm{CH}_3\mathrm{COOH} + \mathrm{NaOH})Energy needed to dissociate weak acid
Strong acid + weak base57.3-57.3 (e.g. HCl+NH3\mathrm{HCl} + \mathrm{NH}_3)Energy needed to dissociate weak base
Weak acid + weak baseVariableDepends on relative strengths

Worked Example: Hess’s Law with Indirect Routes

Section titled “Worked Example: Hess’s Law with Indirect Routes”

Calculate ΔHf\Delta H_f^\circ of CH4(g)\mathrm{CH}_4(g) given:

  • C(s)+O2(g)CO2(g)\mathrm{C}(s) + \mathrm{O}_2(g) \to \mathrm{CO}_2(g); ΔH1=394kJ/mol\Delta H_1 = -394\,\mathrm{kJ/mol}
  • H2(g)+12O2(g)H2O(l)\mathrm{H}_2(g) + \tfrac{1}{2}\mathrm{O}_2(g) \to \mathrm{H}_2\mathrm{O}(l); ΔH2=286kJ/mol\Delta H_2 = -286\,\mathrm{kJ/mol}
  • CH4(g)+2O2(g)CO2(g)+2H2O(l)\mathrm{CH}_4(g) + 2\mathrm{O}_2(g) \to \mathrm{CO}_2(g) + 2\mathrm{H}_2\mathrm{O}(l); ΔH3=890kJ/mol\Delta H_3 = -890\,\mathrm{kJ/mol}

Formation: C(s)+2H2(g)CH4(g)\mathrm{C}(s) + 2\mathrm{H}_2(g) \to \mathrm{CH}_4(g)

By Hess’s Law, route the formation through combustion:

ΔHf+ΔH3=ΔH1+2ΔH2\Delta H_f^\circ + \Delta H_3 = \Delta H_1 + 2\Delta H_2 ΔHf=394+2(286)(890)=394572+890=76kJ/mol\Delta H_f^\circ = -394 + 2(-286) - (-890) = -394 - 572 + 890 = -76\,\mathrm{kJ/mol}
  1. Sign errors in Hess’s Law cycles. When constructing a cycle, ensure all arrows point in the correct direction. If a step is reversed, change the sign of the enthalpy.

  2. Confusing ΔS\Delta S^\circ with SS^\circ. ΔS\Delta S^\circ is the change in entropy; SS^\circ is the absolute entropy of a single species. SS^\circ is always positive; ΔS\Delta S^\circ can be positive or negative.

  3. Using ΔH\Delta H instead of ΔH\Delta H^\circ in Gibbs calculations. Standard values must be used for standard free energy calculations.

  4. Forgetting units in entropy calculations. Entropy is in Jmol1K1\mathrm{J\,mol^{-1}\,K^{-1}}Not kJ\mathrm{kJ}. Always convert ΔH\Delta H to J\mathrm{J} (or ΔS\Delta S to kJ\mathrm{kJ}) before combining in ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S.

  5. Misidentifying the theoretical vs experimental lattice enthalpy in Fajans’ Rules discussions. The experimental (Born-Haber) value is less exothermic when covalent character is present; the theoretical (Born-Lande) value assumes perfect ionic bonding.

  6. Assuming ΔG=0\Delta G = 0 means the reaction has stopped. ΔG=0\Delta G = 0 means the reaction is at equilibrium, not that it has stopped. Both forward and reverse reactions continue at equal rates.

  7. Using the wrong formula for the surroundings entropy. ΔSsurroundings=ΔH/T\Delta S_\mathrm{surroundings} = -\Delta H / T. The negative sign is critical: an exothermic reaction (ΔH<0\Delta H \lt 0) increases the entropy of the surroundings.

Standard Enthalpy of Formation vs Mean Bond Enthalpy

Section titled “Standard Enthalpy of Formation vs Mean Bond Enthalpy”

Standard enthalpies of formation (ΔHf\Delta H_f^\circ) are measured experimentally. Mean bond enthalpies are calculated as averages. When both are available, ΔHf\Delta H_f^\circ data give more accurate results.

When to use bond enthalpies: Use mean bond enthalpies when ΔHf\Delta H_f^\circ data are not available for all species in the reaction (e.g. For gaseous atoms or free radicals).

Worked Example: Bond Enthalpy Calculation for an Unknown Reaction

Section titled “Worked Example: Bond Enthalpy Calculation for an Unknown Reaction”

Calculate ΔH\Delta H for the reaction:

N2(g)+3H2(g)2NH3(g)\mathrm{N}_2(g) + 3\mathrm{H}_2(g) \to 2\mathrm{NH}_3(g)

Using mean bond enthalpies: \mathrm{N}\equiv\mathrm{N} = 945\,\mathrm{kJ/mol}$$\mathrm{H}-\mathrm{H} = 436\,\mathrm{kJ/mol}$$\mathrm{N}-\mathrm{H} = 391\,\mathrm{kJ/mol}.

Bonds broken=1×NN+3×HH=945+3(436)=2253kJ/mol\text{Bonds broken} = 1 \times \mathrm{N}\equiv\mathrm{N} + 3 \times \mathrm{H}-\mathrm{H} = 945 + 3(436) = 2253\,\mathrm{kJ/mol} Bonds formed=6×NH=6(391)=2346kJ/mol\text{Bonds formed} = 6 \times \mathrm{N}-\mathrm{H} = 6(391) = 2346\,\mathrm{kJ/mol} ΔH=22532346=93kJ/mol\Delta H = 2253 - 2346 = -93\,\mathrm{kJ/mol}

The experimental value is 92kJ/mol-92\,\mathrm{kJ/mol}Showing good agreement.

Born-Haber Cycles and Lattice Enthalpy (Summary)

Section titled “Born-Haber Cycles and Lattice Enthalpy (Summary)”
  • Lattice dissociation enthalpy: Enthalpy change when one mole of an ionic lattice is separated into its gaseous ions (endothermic, always positive).
  • Lattice formation enthalpy: Enthalpy change when one mole of an ionic lattice is formed from its gaseous ions (exothermic, always negative).
ΔHlatt(dissociation)=ΔHlatt(formation)\Delta H_\mathrm{latt}(\mathrm{dissociation}) = -\Delta H_\mathrm{latt}(\mathrm{formation})
  1. Ionic charge: Higher charge \to stronger electrostatic attraction \to more exothermic lattice enthalpy. MgO\mathrm{MgO} (\mathrm{Mg}^{2+}$$\mathrm{O}^{2-}) has a much more exothermic lattice enthalpy than NaCl\mathrm{NaCl} (\mathrm{Na}^+$$\mathrm{Cl}^-).
  2. Ionic radius: Smaller ions \to shorter internuclear distance \to stronger attraction \to more exothermic lattice enthalpy. LiF\mathrm{LiF} has a more exothermic lattice enthalpy than NaF\mathrm{NaF} because Li+\mathrm{Li}^+ is smaller than Na+\mathrm{Na}^+.

When the cation is small and highly charged (e.g. Al3+\mathrm{Al}^{3+}) and the anion is large and highly charged (e.g. I\mathrm{I}^-), the electron cloud of the anion is distorted (polarised) towards the cation. This introduces covalent character, making the experimental lattice enthalpy less exothermic than the theoretical (purely ionic) value.

CationAnionCovalent characterExplanation
Na+\mathrm{Na}^+ (large, low charge)Cl\mathrm{Cl}^- (moderate)LowMinimal polarisation
Al3+\mathrm{Al}^{3+} (small, high charge)I\mathrm{I}^- (large)HighStrong polarisation

Worked Example: Born-Haber Cycle for CaCl2\mathrm{CaCl}_2

Section titled “Worked Example: Born-Haber Cycle for CaCl2\mathrm{CaCl}_2CaCl2​”

Construct a Born-Haber cycle for CaCl2(s)\mathrm{CaCl}_2(s) and calculate the lattice enthalpy.

Steps (values are illustrative):

StepDescriptionΔH\Delta H (kJ/mol\mathrm{kJ/mol})
1Ca(s)Ca(g)\mathrm{Ca}(s) \to \mathrm{Ca}(g) (atomisation)+178+178
2Ca(g)Ca+(g)+e\mathrm{Ca}(g) \to \mathrm{Ca}^+(g) + e^- (1st IE)+590+590
3Ca+(g)Ca2+(g)+e\mathrm{Ca}^+(g) \to \mathrm{Ca}^{2+}(g) + e^- (2nd IE)+1145+1145
4Cl2(g)2Cl(g)\mathrm{Cl}_2(g) \to 2\mathrm{Cl}(g) (atomisation)+244+244
52Cl(g)+2e2Cl(g)2\mathrm{Cl}(g) + 2e^- \to 2\mathrm{Cl}^-(g) (1st EA ×2\times 2)728-728
6Ca(s)+Cl2(g)CaCl2(s)\mathrm{Ca}(s) + \mathrm{Cl}_2(g) \to \mathrm{CaCl}_2(s) (ΔHf\Delta H_f^\circ)796-796

Lattice enthalpy (formation):

ΔHlatt=ΔHf(Steps 1–5)=796(178+590+1145+244728)\Delta H_\mathrm{latt} = \Delta H_f^\circ - (\text{Steps 1--5}) = -796 - (178 + 590 + 1145 + 244 - 728) ΔHlatt=7961435=2231kJ/mol\Delta H_\mathrm{latt} = -796 - 1435 = -2231\,\mathrm{kJ/mol}

Predicting the Feasibility of Industrial Processes

Section titled “Predicting the Feasibility of Industrial Processes”

Haber process: N2(g)+3H2(g)2NH3(g)\mathrm{N}_2(g) + 3\mathrm{H}_2(g) \rightleftharpoons 2\mathrm{NH}_3(g)

  • ΔH=92kJ/mol\Delta H^\circ = -92\,\mathrm{kJ/mol} (exothermic)
  • ΔS=199Jmol1K1\Delta S^\circ = -199\,\mathrm{J\,mol^{-1}\,K^{-1}} (4 moles gas \to 2 moles gas)
  • ΔG=ΔHTΔS\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ

At 298K298\,\mathrm{K}: ΔG=92298(0.199)=92+59.3=32.7kJ/mol\Delta G^\circ = -92 - 298(-0.199) = -92 + 59.3 = -32.7\,\mathrm{kJ/mol} (spontaneous, K5.6×105K \approx 5.6 \times 10^5).

At 700K700\,\mathrm{K}: ΔG=92700(0.199)=92+139.3=+47.3kJ/mol\Delta G^\circ = -92 - 700(-0.199) = -92 + 139.3 = +47.3\,\mathrm{kJ/mol} (non-spontaneous).

The Haber process uses high temperature for kinetic reasons (faster rate), despite the thermodynamic penalty. High pressure shifts equilibrium towards products (fewer moles of gas).

Contact process: 2SO2(g)+O2(g)2SO3(g)2\mathrm{SO}_2(g) + \mathrm{O}_2(g) \rightleftharpoons 2\mathrm{SO}_3(g)

  • ΔH=198kJ/mol\Delta H^\circ = -198\,\mathrm{kJ/mol} (exothermic)
  • ΔS=190Jmol1K1\Delta S^\circ = -190\,\mathrm{J\,mol^{-1}\,K^{-1}}
  • Optimal temperature is a compromise: 400400450C450^\circ\mathrm{C} gives acceptable rate and reasonable equilibrium yield. V2O5\mathrm{V}_2\mathrm{O}_5 catalyst lowers the activation energy.
Problem 1

Calculate ΔG\Delta G^\circ at 298K298\,\mathrm{K} for the reaction:

2NO(g)+O2(g)2NO2(g)2\mathrm{NO}(g) + \mathrm{O}_2(g) \to 2\mathrm{NO}_2(g)

Given: \Delta H^\circ = -114\,\mathrm{kJ/mol}$$\Delta S^\circ = -146\,\mathrm{J\,mol^{-1}\,K^{-1}}.

Is the reaction spontaneous?

Solution:

ΔG=ΔHTΔS=114×103298×(146)=114000+43508=70492J/mol=70.5kJ/mol\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ = -114 \times 10^3 - 298 \times (-146) = -114000 + 43508 = -70492\,\mathrm{J/mol} = -70.5\,\mathrm{kJ/mol}

Since ΔG<0\Delta G^\circ \lt 0The reaction is spontaneous at 298K298\,\mathrm{K}. The negative ΔH\Delta H dominates over the unfavourable negative ΔS\Delta S.

Problem 2

The melting of ice: H2O(s)H2O(l)\mathrm{H}_2\mathrm{O}(s) \to \mathrm{H}_2\mathrm{O}(l) has ΔH=+6.01kJ/mol\Delta H^\circ = +6.01\,\mathrm{kJ/mol} and ΔS=+22.0Jmol1K1\Delta S^\circ = +22.0\,\mathrm{J\,mol^{-1}\,K^{-1}}. Calculate the melting point of ice.

Solution:

At the melting point, ΔG=0\Delta G = 0:

T=ΔHΔS=601022.0=273K=0CT = \frac{\Delta H^\circ}{\Delta S^\circ} = \frac{6010}{22.0} = 273\,\mathrm{K} = 0^\circ\mathrm{C}
Problem 3

Use bond enthalpy data to estimate ΔH\Delta H for the hydrogenation of ethyne to ethane:

HCCH(g)+2H2(g)CH3CH3(g)\mathrm{HC}\equiv\mathrm{CH}(g) + 2\mathrm{H}_2(g) \to \mathrm{CH}_3\mathrm{CH}_3(g)

Bond enthalpies: \mathrm{C}\equiv\mathrm{C} = 839\,\mathrm{kJ/mol}$$\mathrm{C}-\mathrm{C} = 347\,\mathrm{kJ/mol}$$\mathrm{C}-\mathrm{H} = 413\,\mathrm{kJ/mol}$$\mathrm{H}-\mathrm{H} = 436\,\mathrm{kJ/mol}.

Solution:

Bonds broken: 1×CC+2×CH+2×HH=839+2(413)+2(436)=839+826+872=2537kJ/mol1 \times \mathrm{C}\equiv\mathrm{C} + 2 \times \mathrm{C}-\mathrm{H} + 2 \times \mathrm{H}-\mathrm{H} = 839 + 2(413) + 2(436) = 839 + 826 + 872 = 2537\,\mathrm{kJ/mol}

Bonds formed: 1×CC+6×CH=347+6(413)=347+2478=2825kJ/mol1 \times \mathrm{C}-\mathrm{C} + 6 \times \mathrm{C}-\mathrm{H} = 347 + 6(413) = 347 + 2478 = 2825\,\mathrm{kJ/mol}

ΔH=(bonds broken)(bonds formed)=25372825=288kJ/mol\Delta H = \sum(\text{bonds broken}) - \sum(\text{bonds formed}) = 2537 - 2825 = -288\,\mathrm{kJ/mol}

The reaction is exothermic, as expected for hydrogenation. Note that mean bond enthalpies are used, so this is an estimate. The experimental value is approximately 312kJ/mol-312\,\mathrm{kJ/mol}; the discrepancy arises because the CH\mathrm{C}-\mathrm{H} bond enthalpy in HCCH\mathrm{HC}\equiv\mathrm{CH} differs from the mean value used.

Problem 4

The decomposition of ammonium chloride:

NH4Cl(s)NH3(g)+HCl(g)\mathrm{NH}_4\mathrm{Cl}(s) \to \mathrm{NH}_3(g) + \mathrm{HCl}(g)

Has ΔH=+176kJ/mol\Delta H^\circ = +176\,\mathrm{kJ/mol} and ΔS=+285Jmol1K1\Delta S^\circ = +285\,\mathrm{J\,mol^{-1}\,K^{-1}}.

(a) Explain why ΔS\Delta S^\circ is positive. (b) Calculate the minimum temperature at which the decomposition becomes spontaneous. (c) State two assumptions made in the calculation.

Solution:

(a) ΔS\Delta S^\circ is positive because one mole of solid produces two moles of gas. Gases have much higher entropy than solids due to the large number of accessible microstates. The increase in the number of gas molecules and the change from a highly ordered solid to freely moving gas molecules both contribute to a large positive entropy change.

(b) At the threshold of spontaneity, ΔG=0\Delta G^\circ = 0:

T=ΔHΔS=176×103285=618K=345CT = \frac{\Delta H^\circ}{\Delta S^\circ} = \frac{176 \times 10^3}{285} = 618\,\mathrm{K} = 345^\circ\mathrm{C}

Above 618\,\mathrm{K}$$\Delta G^\circ \lt 0 and the decomposition is spontaneous.

(c) Assumptions: (i) ΔH\Delta H^\circ and ΔS\Delta S^\circ are constant over the temperature range (they are not strictly constant but vary little for most reactions). (ii) The reaction is at standard pressure (100kPa100\,\mathrm{kPa}).

Problem 5

Use the following standard enthalpies of formation to calculate ΔHf\Delta H_f^\circ for ethanol:

  • ΔHf(C(graphite))=0kJ/mol\Delta H_f^\circ(\mathrm{C}(\text{graphite})) = 0\,\mathrm{kJ/mol}
  • ΔHf(H2(g))=0kJ/mol\Delta H_f^\circ(\mathrm{H}_2(g)) = 0\,\mathrm{kJ/mol}
  • ΔHf(C2H5OH(l))=277kJ/mol\Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l)) = -277\,\mathrm{kJ/mol}
  • ΔHc(C(graphite))=394kJ/mol\Delta H_c^\circ(\mathrm{C}(\text{graphite})) = -394\,\mathrm{kJ/mol}
  • ΔHc(H2(g))=286kJ/mol\Delta H_c^\circ(\mathrm{H}_2(g)) = -286\,\mathrm{kJ/mol}
  • ΔHc(C2H5OH(l))=1367kJ/mol\Delta H_c^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l)) = -1367\,\mathrm{kJ/mol}

Verify the consistency of the data by constructing a Hess’s Law cycle.

Solution:

The combustion of ethanol:

C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)ΔHc=1367kJ/mol\mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) + 3\mathrm{O}_2(g) \to 2\mathrm{CO}_2(g) + 3\mathrm{H}_2\mathrm{O}(l) \quad \Delta H_c = -1367\,\mathrm{kJ/mol}

Route via elements:

2C(graphite)+3H2(g)+12O2(g)C2H5OH(l)ΔHf2\mathrm{C}(\text{graphite}) + 3\mathrm{H}_2(g) + \tfrac{1}{2}\mathrm{O}_2(g) \to \mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) \quad \Delta H_f^\circ

Combustion of elements:

2C(graphite)+2O2(g)2CO2(g)2×(394)=788kJ/mol2\mathrm{C}(\text{graphite}) + 2\mathrm{O}_2(g) \to 2\mathrm{CO}_2(g) \quad 2 \times (-394) = -788\,\mathrm{kJ/mol} 3H2(g)+32O2(g)3H2O(l)3×(286)=858kJ/mol3\mathrm{H}_2(g) + \tfrac{3}{2}\mathrm{O}_2(g) \to 3\mathrm{H}_2\mathrm{O}(l) \quad 3 \times (-286) = -858\,\mathrm{kJ/mol}

By Hess’s Law: ΔHf+ΔHc(ethanol)=2ΔHc(C)+3ΔHc(H2)\Delta H_f^\circ + \Delta H_c^\circ(\text{ethanol}) = 2\Delta H_c^\circ(\mathrm{C}) + 3\Delta H_c^\circ(\mathrm{H}_2)

ΔHf=(788)+(858)(1367)=1646+1367=279kJ/mol\Delta H_f^\circ = (-788) + (-858) - (-1367) = -1646 + 1367 = -279\,\mathrm{kJ/mol}

The calculated value (279kJ/mol-279\,\mathrm{kJ/mol}) is close to the literature value (277kJ/mol-277\,\mathrm{kJ/mol}), confirming consistency. The small discrepancy is within experimental uncertainty.

Problem 6

The enthalpy of neutralisation of NaOH(aq)\mathrm{NaOH}(aq) and CH3COOH(aq)\mathrm{CH}_3\mathrm{COOH}(aq) is 56.1kJ/mol-56.1\,\mathrm{kJ/mol}Whereas the enthalpy of neutralisation of NaOH(aq)\mathrm{NaOH}(aq) and HCl(aq)\mathrm{HCl}(aq) is 57.9kJ/mol-57.9\,\mathrm{kJ/mol}. Explain the difference.

Solution:

The neutralisation of a strong acid (HCl\mathrm{HCl}) with a strong base (NaOH\mathrm{NaOH}) always gives the same value (57.9kJ/mol-57.9\,\mathrm{kJ/mol}) because the net ionic equation is:

H+(aq)+OH(aq)H2O(l)ΔH=57.9kJ/mol\mathrm{H}^+(aq) + \mathrm{OH}^-(aq) \to \mathrm{H}_2\mathrm{O}(l) \quad \Delta H = -57.9\,\mathrm{kJ/mol}

With ethanoic acid (a weak acid), some energy is consumed in dissociating the acid:

CH3COOH(aq)CH3COO(aq)+H+(aq)ΔHdiss+0.4kJ/mol\mathrm{CH}_3\mathrm{COOH}(aq) \rightleftharpoons \mathrm{CH}_3\mathrm{COO}^-(aq) + \mathrm{H}^+(aq) \quad \Delta H_\mathrm{diss} \approx +0.4\,\mathrm{kJ/mol}

The overall enthalpy is the sum of the dissociation and neutralisation:

ΔHneut(weak)=ΔHdiss+ΔHneut(strong)+0.4+(57.9)=57.5kJ/mol\Delta H_\mathrm{neut}(\text{weak}) = \Delta H_\mathrm{diss} + \Delta H_\mathrm{neut}(\text{strong}) \approx +0.4 + (-57.9) = -57.5\,\mathrm{kJ/mol}

The measured value is 56.1kJ/mol-56.1\,\mathrm{kJ/mol}Suggesting additional endothermic contributions (the enthalpy of dissociation of ethanoic acid is endothermic, consuming some of the heat released by neutralisation). The reaction is less exothermic because the weak acid must first dissociate, which is an endothermic process.

The relationship between ΔG\Delta G^\circ and the equilibrium constant:

ΔG=RTlnK\Delta G^\circ = -RT\ln K

This is one of the most important equations in A-Level chemistry. It connects thermodynamics (energetics) with equilibrium (composition).

Worked Example: Calculate KcK_c at 298K298\,\mathrm{K} for a reaction with ΔG=5.40kJ/mol\Delta G^\circ = -5.40\,\mathrm{kJ/mol}.

5400=8.314×298×lnKc-5400 = -8.314 \times 298 \times \ln K_c

lnKc=54008.314×298=54002478=2.179\ln K_c = \frac{5400}{8.314 \times 298} = \frac{5400}{2478} = 2.179

Kc=e2.179=8.84K_c = e^{2.179} = 8.84

Since \Delta G^\circ < 0$$K > 1Confirming the reaction is spontaneous and products are favoured at equilibrium.

Worked Example: Calculate the temperature at which ΔG=0\Delta G = 0 for the reaction N2O4(g)2NO2(g)\mathrm{N}_2\mathrm{O}_4(g) \rightleftharpoons 2\mathrm{NO}_2(g)Given ΔH=+57.2kJ/mol\Delta H^\circ = +57.2\,\mathrm{kJ/mol} and \Delta S^\circ = +175.8\,\mathrm{J\,K^{-1}\,\mathrm{mol}^{-1}.

At ΔG=0\Delta G = 0: 0=ΔHTΔS0 = \Delta H^\circ - T\Delta S^\circ

T=ΔHΔS=57200175.8=325KT = \frac{\Delta H^\circ}{\Delta S^\circ} = \frac{57200}{175.8} = 325\,\mathrm{K}

Below 325K325\,\mathrm{K}, ΔG<0\Delta G < 0 and the forward reaction is spontaneous. Above 325K325\,\mathrm{K}, ΔG>0\Delta G > 0 and the reverse reaction is spontaneous. At 325K325\,\mathrm{K}The system is at equilibrium (K=1K = 1).

Worked Example: Calculate ΔS\Delta S^\circ for the reaction CaCO3(s)CaO(s)+CO2(g)\mathrm{CaCO}_3(s) \to \mathrm{CaO}(s) + \mathrm{CO}_2(g).

SS^\circ values: \mathrm{CaCO}_3(s) = 92.9\,\mathrm{J\,K^{-1}\,\mathrm{mol}^{-1}}$$\mathrm{CaO}(s) = 38.1\,\mathrm{J\,K^{-1}\mathrm{mol}^{-1}}$$\mathrm{CO}_2(g) = 213.7\,\mathrm{J\,K^{-1}\mathrm{mol}^{-1}}.

ΔS=S(CaO)+S(CO2)S(CaCO3)\Delta S^\circ = S^\circ(\mathrm{CaO}) + S^\circ(\mathrm{CO}_2) - S^\circ(\mathrm{CaCO}_3)

=38.1+213.792.9=158.9JK1mol1= 38.1 + 213.7 - 92.9 = 158.9\,\mathrm{J\,K^{-1}\mathrm{mol}^{-1}}

The entropy change is positive, as expected: a solid decomposes to give a gas (increased disorder).

Worked Example: Use Hess’s Law to calculate ΔHf\Delta H_f^\circ for C2H5OH(l)\mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l).

Given data:

  • C(s)+O2(g)CO2(g)\mathrm{C}(s) + \mathrm{O}_2(g) \to \mathrm{CO}_2(g), ΔH=393.5kJ/mol\Delta H = -393.5\,\mathrm{kJ/mol}
  • H2(g)+12O2(g)H2O(l)\mathrm{H}_2(g) + \frac{1}{2}\mathrm{O}_2(g) \to \mathrm{H}_2\mathrm{O}(l), ΔH=285.8kJ/mol\Delta H = -285.8\,\mathrm{kJ/mol}
  • C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)\mathrm{C}_2\mathrm{H}_5\mathrm{OH}(l) + 3\mathrm{O}_2(g) \to 2\mathrm{CO}_2(g) + 3\mathrm{H}_2\mathrm{O}(l), ΔH=1367kJ/mol\Delta H = -1367\,\mathrm{kJ/mol}

By Hess’s Law:

2(CCO2)+3(H2+12O2H2O)(C2H5OH+3O22CO2+3H2O)=ΔHf(C2H5OH)2(\mathrm{C} \to \mathrm{CO}_2) + 3(\mathrm{H}_2 + \tfrac{1}{2}\mathrm{O}_2 \to \mathrm{H}_2\mathrm{O}) - (\mathrm{C}_2\mathrm{H}_5\mathrm{OH} + 3\mathrm{O}_2 \to 2\mathrm{CO}_2 + 3\mathrm{H}_2\mathrm{O}) = \Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH})

2(393.5)+3(285.8)(1367)=787.0857.4+1367=277.4kJ/mol2(-393.5) + 3(-285.8) - (-1367) = -787.0 - 857.4 + 1367 = -277.4\,\mathrm{kJ/mol}

ΔHf(C2H5OH)=277kJ/mol\Delta H_f^\circ(\mathrm{C}_2\mathrm{H}_5\mathrm{OH}) = -277\,\mathrm{kJ/mol} (to 3 s.f.)

Worked Example: Is the reduction of TiO2\mathrm{TiO}_2 to Ti\mathrm{Ti} by carbon thermodynamically feasible at 1500K1500\,\mathrm{K}?

TiO2(s)+2C(s)Ti(s)+2CO(g)\mathrm{TiO}_2(s) + 2\mathrm{C}(s) \to \mathrm{Ti}(s) + 2\mathrm{CO}(g)

ΔH=+877kJ/mol\Delta H^\circ = +877\,\mathrm{kJ/mol}, \Delta S^\circ = +193\,\mathrm{J\,K^{-1}\mathrm{mol}^{-1}

ΔG=ΔHTΔS=8770001500×193=877000289500=587500J/mol=+588kJ/mol\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ = 877000 - 1500 \times 193 = 877000 - 289500 = 587500\,\mathrm{J/mol} = +588\,\mathrm{kJ/mol}

ΔG>0\Delta G^\circ > 0So the reaction is not thermodynamically feasible at 1500K1500\,\mathrm{K}.

At what temperature does it become feasible?

T=ΔHΔS=877000193=4544KT = \frac{\Delta H^\circ}{\Delta S^\circ} = \frac{877000}{193} = 4544\,\mathrm{K}

The reaction becomes feasible above approximately 4544K4544\,\mathrm{K} (extremely high temperature, impractical). In practice, the Kroll process (reduction with Mg\mathrm{Mg} or Cl2\mathrm{Cl}_2) is used.

Exam-Style Questions with Full Mark Schemes

Section titled “Exam-Style Questions with Full Mark Schemes”
Q1 (5 marks)

Define the term standard enthalpy change of reaction, ΔHr\Delta H^\circ_\mathrm{r}. Explain why the standard enthalpy change of neutralisation of a strong acid with a strong base is always approximately 57kJ/mol-57\,\mathrm{kJ/mol} regardless of which strong acid and strong base are used.

Mark Scheme:

ΔHr\Delta H^\circ_\mathrm{r} is the enthalpy change when the reaction occurs under standard conditions with all reactants and products in their standard states (1 mark).

The neutralisation of any strong acid with any strong base has the same net ionic equation:

H+(aq)+OH(aq)H2O(l)\mathrm{H}^+(aq) + \mathrm{OH}^-(aq) \to \mathrm{H}_2\mathrm{O}(l) (1 mark).

The specific acid and base are irrelevant because strong acids and bases are fully dissociated in solution (1 mark). The enthalpy change depends only on the formation of the O—H bond in water, which is the same in every case (1 mark). Minor differences arise from the enthalpies of dilution of different ions (1 mark).

Q2 (6 marks)

For the reaction A(g)+2B(g)C(g)+D(g)\mathrm{A}(g) + 2\mathrm{B}(g) \to \mathrm{C}(g) + \mathrm{D}(g):

ΔH=85kJ/mol\Delta H^\circ = -85\,\mathrm{kJ/mol}, \Delta S^\circ = -120\,\mathrm{J\,K^{-1}\mathrm{mol}^{-1}

(a) Calculate ΔG\Delta G^\circ at 298K298\,\mathrm{K}. (2 marks)

(b) State whether the reaction is feasible at 298K298\,\mathrm{K}Explaining your answer. (1 mark)

(c) Calculate the temperature above which the reaction becomes non-spontaneous. (2 marks)

(d) State the effect of increasing the pressure on the position of equilibrium. (1 mark)

Mark Scheme:

(a) ΔG=ΔHTΔS=85000298×(120)=85000+35760=49240J/mol=49.2kJ/mol\Delta G^\circ = \Delta H^\circ - T\Delta S^\circ = -85000 - 298 \times (-120) = -85000 + 35760 = -49240\,\mathrm{J/mol} = -49.2\,\mathrm{kJ/mol} (1 mark for substitution, 1 mark for answer).

(b) ΔG<0\Delta G^\circ < 0So the reaction is feasible (spontaneous) at 298K298\,\mathrm{K} (1 mark).

(c) ΔG=0\Delta G^\circ = 0: T=ΔHΔS=85000120=708KT = \frac{\Delta H^\circ}{\Delta S^\circ} = \frac{-85000}{-120} = 708\,\mathrm{K} (1 mark). Above 708K708\,\mathrm{K}, ΔG>0\Delta G^\circ > 0 and the reaction is non-spontaneous (1 mark).

(d) 3 moles of gas on the left, 2 moles on the right. Increasing pressure favours the side with fewer moles (products), shifting the equilibrium to the right (1 mark).

Q3 (4 marks)

Explain why the entropy change for the reaction NH4Cl(s)NH3(g)+HCl(g)\mathrm{NH}_4\mathrm{Cl}(s) \to \mathrm{NH}_3(g) + \mathrm{HCl}(g) is positive.

Mark Scheme:

A solid is converted into two gases (2 marks). Gases have much higher entropy than solids because the particles are free to move in all directions (1 mark). The number of particles increases from 1 to 2, and the disorder increases (1 mark).

Q4 (5 marks)

Use the following data to calculate the lattice enthalpy of KCl\mathrm{KCl} using a Born-Haber cycle:

  • ΔHf(KCl)=437kJ/mol\Delta H_f^\circ(\mathrm{KCl}) = -437\,\mathrm{kJ/mol}
  • ΔHat(K)=+89kJ/mol\Delta H_\mathrm{at}^\circ(\mathrm{K}) = +89\,\mathrm{kJ/mol}
  • ΔHat(Cl)=+122kJ/mol\Delta H_\mathrm{at}^\circ(\mathrm{Cl}) = +122\,\mathrm{kJ/mol}
  • IE1(K)=+419kJ/mol\mathrm{IE}_1(\mathrm{K}) = +419\,\mathrm{kJ/mol}
  • EA1(Cl)=349kJ/mol\mathrm{EA}_1(\mathrm{Cl}) = -349\,\mathrm{kJ/mol}

Mark Scheme:

ΔHlat=ΔHfΔHat(K)ΔHat(Cl)IE1(K)EA1(Cl)\Delta H_\mathrm{lat}^\circ = \Delta H_f^\circ - \Delta H_\mathrm{at}^\circ(\mathrm{K}) - \Delta H_\mathrm{at}^\circ(\mathrm{Cl}) - \mathrm{IE}_1(\mathrm{K}) - \mathrm{EA}_1(\mathrm{Cl}) (1 mark for equation)

=43789122419(349)= -437 - 89 - 122 - 419 - (-349) (1 mark for substitution)

=43789122419+349=718kJ/mol= -437 - 89 - 122 - 419 + 349 = -718\,\mathrm{kJ/mol} (1 mark for arithmetic)

The lattice enthalpy of KCl is 718kJ/mol-718\,\mathrm{kJ/mol} (1 mark for answer with sign).

The negative sign indicates the process of forming the ionic lattice from gaseous ions is exothermic (1 mark).